From 2eb103528625b68fba5d65a09b830b9dd2249ba0 Mon Sep 17 00:00:00 2001 From: Diego Waxemberg Date: Tue, 3 Dec 2013 23:53:12 -0500 Subject: [PATCH] added files from limelight from android --- limelight-pc/.classpath | 6 + limelight-pc/.project | 17 + .../.settings/org.eclipse.jdt.core.prefs | 7 + .../jni/nv_opus_dec/libopus/inc/opus.h | 906 ++++++++++++++++++ .../jni/nv_opus_dec/libopus/inc/opus_custom.h | 329 +++++++ .../nv_opus_dec/libopus/inc/opus_defines.h | 655 +++++++++++++ .../libopus/inc/opus_multistream.h | 660 +++++++++++++ .../jni/nv_opus_dec/libopus/inc/opus_types.h | 159 +++ .../jni/nv_opus_dec/libopus/nv_opus_dec.c | 54 ++ .../jni/nv_opus_dec/libopus/nv_opus_dec.h | 6 + .../jni/nv_opus_dec/libopus/nv_opus_dec_jni.c | 68 ++ .../src/com/limelight/#Limelight.java# | 30 + limelight-pc/src/com/limelight/Limelight.java | 66 ++ .../src/com/limelight/gui/MainFrame.java | 90 ++ .../src/com/limelight/gui/StreamFrame.java | 11 + .../com/limelight/input/KeyboardHandler.java | 23 + .../src/com/limelight/nvstream/NvApp.java | 31 + .../com/limelight/nvstream/NvAudioStream.java | 250 +++++ .../com/limelight/nvstream/NvConnection.java | 245 +++++ .../nvstream/NvConnectionListener.java | 30 + .../src/com/limelight/nvstream/NvControl.java | 483 ++++++++++ .../src/com/limelight/nvstream/NvHTTP.java | 144 +++ .../com/limelight/nvstream/NvHandshake.java | 133 +++ .../com/limelight/nvstream/NvVideoStream.java | 307 ++++++ .../nvstream/av/AvByteBufferDescriptor.java | 46 + .../limelight/nvstream/av/AvDecodeUnit.java | 42 + .../limelight/nvstream/av/AvRtpPacket.java | 46 + .../nvstream/av/AvShortBufferDescriptor.java | 28 + .../nvstream/av/ConnectionStatusListener.java | 7 + .../av/audio/AvAudioDepacketizer.java | 65 ++ .../nvstream/av/audio/OpusDecoder.java | 14 + .../av/video/AvVideoDepacketizer.java | 313 ++++++ .../nvstream/av/video/AvVideoPacket.java | 17 + .../nvstream/av/video/AvcDecoder.java | 33 + .../nvstream/av/video/CpuDecoderRenderer.java | 203 ++++ .../nvstream/av/video/DecoderRenderer.java | 17 + .../nvstream/input/NvController.java | 65 ++ .../nvstream/input/NvControllerPacket.java | 89 ++ .../nvstream/input/NvInputPacket.java | 26 + .../nvstream/input/NvMouseButtonPacket.java | 36 + .../nvstream/input/NvMouseMovePacket.java | 42 + 41 files changed, 5799 insertions(+) create mode 100644 limelight-pc/.classpath create mode 100644 limelight-pc/.project create mode 100644 limelight-pc/.settings/org.eclipse.jdt.core.prefs create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/inc/opus.h create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/inc/opus_custom.h create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/inc/opus_defines.h create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/inc/opus_multistream.h create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/inc/opus_types.h create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.c create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.h create mode 100644 limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec_jni.c create mode 100644 limelight-pc/src/com/limelight/#Limelight.java# create mode 100644 limelight-pc/src/com/limelight/Limelight.java create mode 100644 limelight-pc/src/com/limelight/gui/MainFrame.java create mode 100644 limelight-pc/src/com/limelight/gui/StreamFrame.java create mode 100644 limelight-pc/src/com/limelight/input/KeyboardHandler.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvApp.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvAudioStream.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvConnection.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvConnectionListener.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvControl.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvHTTP.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvHandshake.java create mode 100644 limelight-pc/src/com/limelight/nvstream/NvVideoStream.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/AvByteBufferDescriptor.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/AvDecodeUnit.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/AvRtpPacket.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/AvShortBufferDescriptor.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/ConnectionStatusListener.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/audio/AvAudioDepacketizer.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/audio/OpusDecoder.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/video/AvVideoDepacketizer.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/video/AvVideoPacket.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/video/AvcDecoder.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/video/CpuDecoderRenderer.java create mode 100644 limelight-pc/src/com/limelight/nvstream/av/video/DecoderRenderer.java create mode 100644 limelight-pc/src/com/limelight/nvstream/input/NvController.java create mode 100644 limelight-pc/src/com/limelight/nvstream/input/NvControllerPacket.java create mode 100644 limelight-pc/src/com/limelight/nvstream/input/NvInputPacket.java create mode 100644 limelight-pc/src/com/limelight/nvstream/input/NvMouseButtonPacket.java create mode 100644 limelight-pc/src/com/limelight/nvstream/input/NvMouseMovePacket.java diff --git a/limelight-pc/.classpath b/limelight-pc/.classpath new file mode 100644 index 0000000..18d70f0 --- /dev/null +++ b/limelight-pc/.classpath @@ -0,0 +1,6 @@ + + + + + + diff --git a/limelight-pc/.project b/limelight-pc/.project new file mode 100644 index 0000000..93d324d --- /dev/null +++ b/limelight-pc/.project @@ -0,0 +1,17 @@ + + + limelight-pc + + + + + + org.eclipse.jdt.core.javabuilder + + + + + + org.eclipse.jdt.core.javanature + + diff --git a/limelight-pc/.settings/org.eclipse.jdt.core.prefs b/limelight-pc/.settings/org.eclipse.jdt.core.prefs new file mode 100644 index 0000000..c537b63 --- /dev/null +++ b/limelight-pc/.settings/org.eclipse.jdt.core.prefs @@ -0,0 +1,7 @@ +eclipse.preferences.version=1 +org.eclipse.jdt.core.compiler.codegen.inlineJsrBytecode=enabled +org.eclipse.jdt.core.compiler.codegen.targetPlatform=1.6 +org.eclipse.jdt.core.compiler.compliance=1.6 +org.eclipse.jdt.core.compiler.problem.assertIdentifier=error +org.eclipse.jdt.core.compiler.problem.enumIdentifier=error +org.eclipse.jdt.core.compiler.source=1.6 diff --git a/limelight-pc/jni/nv_opus_dec/libopus/inc/opus.h b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus.h new file mode 100644 index 0000000..ce86038 --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus.h @@ -0,0 +1,906 @@ +/* Copyright (c) 2010-2011 Xiph.Org Foundation, Skype Limited + Written by Jean-Marc Valin and Koen Vos */ +/* + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + - Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + - Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER + OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF + LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/** + * @file opus.h + * @brief Opus reference implementation API + */ + +#ifndef OPUS_H +#define OPUS_H + +#include "opus_types.h" +#include "opus_defines.h" + +#ifdef __cplusplus +extern "C" { +#endif + +/** + * @mainpage Opus + * + * The Opus codec is designed for interactive speech and audio transmission over the Internet. + * It is designed by the IETF Codec Working Group and incorporates technology from + * Skype's SILK codec and Xiph.Org's CELT codec. + * + * The Opus codec is designed to handle a wide range of interactive audio applications, + * including Voice over IP, videoconferencing, in-game chat, and even remote live music + * performances. It can scale from low bit-rate narrowband speech to very high quality + * stereo music. Its main features are: + + * @li Sampling rates from 8 to 48 kHz + * @li Bit-rates from 6 kb/s to 510 kb/s + * @li Support for both constant bit-rate (CBR) and variable bit-rate (VBR) + * @li Audio bandwidth from narrowband to full-band + * @li Support for speech and music + * @li Support for mono and stereo + * @li Support for multichannel (up to 255 channels) + * @li Frame sizes from 2.5 ms to 60 ms + * @li Good loss robustness and packet loss concealment (PLC) + * @li Floating point and fixed-point implementation + * + * Documentation sections: + * @li @ref opus_encoder + * @li @ref opus_decoder + * @li @ref opus_repacketizer + * @li @ref opus_multistream + * @li @ref opus_libinfo + * @li @ref opus_custom + */ + +/** @defgroup opus_encoder Opus Encoder + * @{ + * + * @brief This page describes the process and functions used to encode Opus. + * + * Since Opus is a stateful codec, the encoding process starts with creating an encoder + * state. This can be done with: + * + * @code + * int error; + * OpusEncoder *enc; + * enc = opus_encoder_create(Fs, channels, application, &error); + * @endcode + * + * From this point, @c enc can be used for encoding an audio stream. An encoder state + * @b must @b not be used for more than one stream at the same time. Similarly, the encoder + * state @b must @b not be re-initialized for each frame. + * + * While opus_encoder_create() allocates memory for the state, it's also possible + * to initialize pre-allocated memory: + * + * @code + * int size; + * int error; + * OpusEncoder *enc; + * size = opus_encoder_get_size(channels); + * enc = malloc(size); + * error = opus_encoder_init(enc, Fs, channels, application); + * @endcode + * + * where opus_encoder_get_size() returns the required size for the encoder state. Note that + * future versions of this code may change the size, so no assuptions should be made about it. + * + * The encoder state is always continuous in memory and only a shallow copy is sufficient + * to copy it (e.g. memcpy()) + * + * It is possible to change some of the encoder's settings using the opus_encoder_ctl() + * interface. All these settings already default to the recommended value, so they should + * only be changed when necessary. The most common settings one may want to change are: + * + * @code + * opus_encoder_ctl(enc, OPUS_SET_BITRATE(bitrate)); + * opus_encoder_ctl(enc, OPUS_SET_COMPLEXITY(complexity)); + * opus_encoder_ctl(enc, OPUS_SET_SIGNAL(signal_type)); + * @endcode + * + * where + * + * @arg bitrate is in bits per second (b/s) + * @arg complexity is a value from 1 to 10, where 1 is the lowest complexity and 10 is the highest + * @arg signal_type is either OPUS_AUTO (default), OPUS_SIGNAL_VOICE, or OPUS_SIGNAL_MUSIC + * + * See @ref opus_encoderctls and @ref opus_genericctls for a complete list of parameters that can be set or queried. Most parameters can be set or changed at any time during a stream. + * + * To encode a frame, opus_encode() or opus_encode_float() must be called with exactly one frame (2.5, 5, 10, 20, 40 or 60 ms) of audio data: + * @code + * len = opus_encode(enc, audio_frame, frame_size, packet, max_packet); + * @endcode + * + * where + * + * + * opus_encode() and opus_encode_float() return the number of bytes actually written to the packet. + * The return value can be negative, which indicates that an error has occurred. If the return value + * is 1 byte, then the packet does not need to be transmitted (DTX). + * + * Once the encoder state if no longer needed, it can be destroyed with + * + * @code + * opus_encoder_destroy(enc); + * @endcode + * + * If the encoder was created with opus_encoder_init() rather than opus_encoder_create(), + * then no action is required aside from potentially freeing the memory that was manually + * allocated for it (calling free(enc) for the example above) + * + */ + +/** Opus encoder state. + * This contains the complete state of an Opus encoder. + * It is position independent and can be freely copied. + * @see opus_encoder_create,opus_encoder_init + */ +typedef struct OpusEncoder OpusEncoder; + +/** Gets the size of an OpusEncoder structure. + * @param[in] channels int: Number of channels. + * This must be 1 or 2. + * @returns The size in bytes. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_encoder_get_size(int channels); + +/** + */ + +/** Allocates and initializes an encoder state. + * There are three coding modes: + * + * @ref OPUS_APPLICATION_VOIP gives best quality at a given bitrate for voice + * signals. It enhances the input signal by high-pass filtering and + * emphasizing formants and harmonics. Optionally it includes in-band + * forward error correction to protect against packet loss. Use this + * mode for typical VoIP applications. Because of the enhancement, + * even at high bitrates the output may sound different from the input. + * + * @ref OPUS_APPLICATION_AUDIO gives best quality at a given bitrate for most + * non-voice signals like music. Use this mode for music and mixed + * (music/voice) content, broadcast, and applications requiring less + * than 15 ms of coding delay. + * + * @ref OPUS_APPLICATION_RESTRICTED_LOWDELAY configures low-delay mode that + * disables the speech-optimized mode in exchange for slightly reduced delay. + * This mode can only be set on an newly initialized or freshly reset encoder + * because it changes the codec delay. + * + * This is useful when the caller knows that the speech-optimized modes will not be needed (use with caution). + * @param [in] Fs opus_int32: Sampling rate of input signal (Hz) + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param [in] channels int: Number of channels (1 or 2) in input signal + * @param [in] application int: Coding mode (@ref OPUS_APPLICATION_VOIP/@ref OPUS_APPLICATION_AUDIO/@ref OPUS_APPLICATION_RESTRICTED_LOWDELAY) + * @param [out] error int*: @ref opus_errorcodes + * @note Regardless of the sampling rate and number channels selected, the Opus encoder + * can switch to a lower audio bandwidth or number of channels if the bitrate + * selected is too low. This also means that it is safe to always use 48 kHz stereo input + * and let the encoder optimize the encoding. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT OpusEncoder *opus_encoder_create( + opus_int32 Fs, + int channels, + int application, + int *error +); + +/** Initializes a previously allocated encoder state + * The memory pointed to by st must be at least the size returned by opus_encoder_get_size(). + * This is intended for applications which use their own allocator instead of malloc. + * @see opus_encoder_create(),opus_encoder_get_size() + * To reset a previously initialized state, use the #OPUS_RESET_STATE CTL. + * @param [in] st OpusEncoder*: Encoder state + * @param [in] Fs opus_int32: Sampling rate of input signal (Hz) + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param [in] channels int: Number of channels (1 or 2) in input signal + * @param [in] application int: Coding mode (OPUS_APPLICATION_VOIP/OPUS_APPLICATION_AUDIO/OPUS_APPLICATION_RESTRICTED_LOWDELAY) + * @retval #OPUS_OK Success or @ref opus_errorcodes + */ +OPUS_EXPORT int opus_encoder_init( + OpusEncoder *st, + opus_int32 Fs, + int channels, + int application +) OPUS_ARG_NONNULL(1); + +/** Encodes an Opus frame. + * @param [in] st OpusEncoder*: Encoder state + * @param [in] pcm opus_int16*: Input signal (interleaved if 2 channels). length is frame_size*channels*sizeof(opus_int16) + * @param [in] frame_size int: Number of samples per channel in the + * input signal. + * This must be an Opus frame size for + * the encoder's sampling rate. + * For example, at 48 kHz the permitted + * values are 120, 240, 480, 960, 1920, + * and 2880. + * Passing in a duration of less than + * 10 ms (480 samples at 48 kHz) will + * prevent the encoder from using the LPC + * or hybrid modes. + * @param [out] data unsigned char*: Output payload. + * This must contain storage for at + * least \a max_data_bytes. + * @param [in] max_data_bytes opus_int32: Size of the allocated + * memory for the output + * payload. This may be + * used to impose an upper limit on + * the instant bitrate, but should + * not be used as the only bitrate + * control. Use #OPUS_SET_BITRATE to + * control the bitrate. + * @returns The length of the encoded packet (in bytes) on success or a + * negative error code (see @ref opus_errorcodes) on failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_encode( + OpusEncoder *st, + const opus_int16 *pcm, + int frame_size, + unsigned char *data, + opus_int32 max_data_bytes +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2) OPUS_ARG_NONNULL(4); + +/** Encodes an Opus frame from floating point input. + * @param [in] st OpusEncoder*: Encoder state + * @param [in] pcm float*: Input in float format (interleaved if 2 channels), with a normal range of +/-1.0. + * Samples with a range beyond +/-1.0 are supported but will + * be clipped by decoders using the integer API and should + * only be used if it is known that the far end supports + * extended dynamic range. + * length is frame_size*channels*sizeof(float) + * @param [in] frame_size int: Number of samples per channel in the + * input signal. + * This must be an Opus frame size for + * the encoder's sampling rate. + * For example, at 48 kHz the permitted + * values are 120, 240, 480, 960, 1920, + * and 2880. + * Passing in a duration of less than + * 10 ms (480 samples at 48 kHz) will + * prevent the encoder from using the LPC + * or hybrid modes. + * @param [out] data unsigned char*: Output payload. + * This must contain storage for at + * least \a max_data_bytes. + * @param [in] max_data_bytes opus_int32: Size of the allocated + * memory for the output + * payload. This may be + * used to impose an upper limit on + * the instant bitrate, but should + * not be used as the only bitrate + * control. Use #OPUS_SET_BITRATE to + * control the bitrate. + * @returns The length of the encoded packet (in bytes) on success or a + * negative error code (see @ref opus_errorcodes) on failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_encode_float( + OpusEncoder *st, + const float *pcm, + int frame_size, + unsigned char *data, + opus_int32 max_data_bytes +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2) OPUS_ARG_NONNULL(4); + +/** Frees an OpusEncoder allocated by opus_encoder_create(). + * @param[in] st OpusEncoder*: State to be freed. + */ +OPUS_EXPORT void opus_encoder_destroy(OpusEncoder *st); + +/** Perform a CTL function on an Opus encoder. + * + * Generally the request and subsequent arguments are generated + * by a convenience macro. + * @param st OpusEncoder*: Encoder state. + * @param request This and all remaining parameters should be replaced by one + * of the convenience macros in @ref opus_genericctls or + * @ref opus_encoderctls. + * @see opus_genericctls + * @see opus_encoderctls + */ +OPUS_EXPORT int opus_encoder_ctl(OpusEncoder *st, int request, ...) OPUS_ARG_NONNULL(1); +/**@}*/ + +/** @defgroup opus_decoder Opus Decoder + * @{ + * + * @brief This page describes the process and functions used to decode Opus. + * + * The decoding process also starts with creating a decoder + * state. This can be done with: + * @code + * int error; + * OpusDecoder *dec; + * dec = opus_decoder_create(Fs, channels, &error); + * @endcode + * where + * @li Fs is the sampling rate and must be 8000, 12000, 16000, 24000, or 48000 + * @li channels is the number of channels (1 or 2) + * @li error will hold the error code in case of failure (or #OPUS_OK on success) + * @li the return value is a newly created decoder state to be used for decoding + * + * While opus_decoder_create() allocates memory for the state, it's also possible + * to initialize pre-allocated memory: + * @code + * int size; + * int error; + * OpusDecoder *dec; + * size = opus_decoder_get_size(channels); + * dec = malloc(size); + * error = opus_decoder_init(dec, Fs, channels); + * @endcode + * where opus_decoder_get_size() returns the required size for the decoder state. Note that + * future versions of this code may change the size, so no assuptions should be made about it. + * + * The decoder state is always continuous in memory and only a shallow copy is sufficient + * to copy it (e.g. memcpy()) + * + * To decode a frame, opus_decode() or opus_decode_float() must be called with a packet of compressed audio data: + * @code + * frame_size = opus_decode(dec, packet, len, decoded, max_size, 0); + * @endcode + * where + * + * @li packet is the byte array containing the compressed data + * @li len is the exact number of bytes contained in the packet + * @li decoded is the decoded audio data in opus_int16 (or float for opus_decode_float()) + * @li max_size is the max duration of the frame in samples (per channel) that can fit into the decoded_frame array + * + * opus_decode() and opus_decode_float() return the number of samples (per channel) decoded from the packet. + * If that value is negative, then an error has occurred. This can occur if the packet is corrupted or if the audio + * buffer is too small to hold the decoded audio. + * + * Opus is a stateful codec with overlapping blocks and as a result Opus + * packets are not coded independently of each other. Packets must be + * passed into the decoder serially and in the correct order for a correct + * decode. Lost packets can be replaced with loss concealment by calling + * the decoder with a null pointer and zero length for the missing packet. + * + * A single codec state may only be accessed from a single thread at + * a time and any required locking must be performed by the caller. Separate + * streams must be decoded with separate decoder states and can be decoded + * in parallel unless the library was compiled with NONTHREADSAFE_PSEUDOSTACK + * defined. + * + */ + +/** Opus decoder state. + * This contains the complete state of an Opus decoder. + * It is position independent and can be freely copied. + * @see opus_decoder_create,opus_decoder_init + */ +typedef struct OpusDecoder OpusDecoder; + +/** Gets the size of an OpusDecoder structure. + * @param [in] channels int: Number of channels. + * This must be 1 or 2. + * @returns The size in bytes. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_decoder_get_size(int channels); + +/** Allocates and initializes a decoder state. + * @param [in] Fs opus_int32: Sample rate to decode at (Hz). + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param [in] channels int: Number of channels (1 or 2) to decode + * @param [out] error int*: #OPUS_OK Success or @ref opus_errorcodes + * + * Internally Opus stores data at 48000 Hz, so that should be the default + * value for Fs. However, the decoder can efficiently decode to buffers + * at 8, 12, 16, and 24 kHz so if for some reason the caller cannot use + * data at the full sample rate, or knows the compressed data doesn't + * use the full frequency range, it can request decoding at a reduced + * rate. Likewise, the decoder is capable of filling in either mono or + * interleaved stereo pcm buffers, at the caller's request. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT OpusDecoder *opus_decoder_create( + opus_int32 Fs, + int channels, + int *error +); + +/** Initializes a previously allocated decoder state. + * The state must be at least the size returned by opus_decoder_get_size(). + * This is intended for applications which use their own allocator instead of malloc. @see opus_decoder_create,opus_decoder_get_size + * To reset a previously initialized state, use the #OPUS_RESET_STATE CTL. + * @param [in] st OpusDecoder*: Decoder state. + * @param [in] Fs opus_int32: Sampling rate to decode to (Hz). + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param [in] channels int: Number of channels (1 or 2) to decode + * @retval #OPUS_OK Success or @ref opus_errorcodes + */ +OPUS_EXPORT int opus_decoder_init( + OpusDecoder *st, + opus_int32 Fs, + int channels +) OPUS_ARG_NONNULL(1); + +/** Decode an Opus packet. + * @param [in] st OpusDecoder*: Decoder state + * @param [in] data char*: Input payload. Use a NULL pointer to indicate packet loss + * @param [in] len opus_int32: Number of bytes in payload* + * @param [out] pcm opus_int16*: Output signal (interleaved if 2 channels). length + * is frame_size*channels*sizeof(opus_int16) + * @param [in] frame_size Number of samples per channel of available space in \a pcm. + * If this is less than the maximum packet duration (120ms; 5760 for 48kHz), this function will + * not be capable of decoding some packets. In the case of PLC (data==NULL) or FEC (decode_fec=1), + * then frame_size needs to be exactly the duration of audio that is missing, otherwise the + * decoder will not be in the optimal state to decode the next incoming packet. For the PLC and + * FEC cases, frame_size must be a multiple of 2.5 ms. + * @param [in] decode_fec int: Flag (0 or 1) to request that any in-band forward error correction data be + * decoded. If no such data is available, the frame is decoded as if it were lost. + * @returns Number of decoded samples or @ref opus_errorcodes + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_decode( + OpusDecoder *st, + const unsigned char *data, + opus_int32 len, + opus_int16 *pcm, + int frame_size, + int decode_fec +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Decode an Opus packet with floating point output. + * @param [in] st OpusDecoder*: Decoder state + * @param [in] data char*: Input payload. Use a NULL pointer to indicate packet loss + * @param [in] len opus_int32: Number of bytes in payload + * @param [out] pcm float*: Output signal (interleaved if 2 channels). length + * is frame_size*channels*sizeof(float) + * @param [in] frame_size Number of samples per channel of available space in \a pcm. + * If this is less than the maximum packet duration (120ms; 5760 for 48kHz), this function will + * not be capable of decoding some packets. In the case of PLC (data==NULL) or FEC (decode_fec=1), + * then frame_size needs to be exactly the duration of audio that is missing, otherwise the + * decoder will not be in the optimal state to decode the next incoming packet. For the PLC and + * FEC cases, frame_size must be a multiple of 2.5 ms. + * @param [in] decode_fec int: Flag (0 or 1) to request that any in-band forward error correction data be + * decoded. If no such data is available the frame is decoded as if it were lost. + * @returns Number of decoded samples or @ref opus_errorcodes + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_decode_float( + OpusDecoder *st, + const unsigned char *data, + opus_int32 len, + float *pcm, + int frame_size, + int decode_fec +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Perform a CTL function on an Opus decoder. + * + * Generally the request and subsequent arguments are generated + * by a convenience macro. + * @param st OpusDecoder*: Decoder state. + * @param request This and all remaining parameters should be replaced by one + * of the convenience macros in @ref opus_genericctls or + * @ref opus_decoderctls. + * @see opus_genericctls + * @see opus_decoderctls + */ +OPUS_EXPORT int opus_decoder_ctl(OpusDecoder *st, int request, ...) OPUS_ARG_NONNULL(1); + +/** Frees an OpusDecoder allocated by opus_decoder_create(). + * @param[in] st OpusDecoder*: State to be freed. + */ +OPUS_EXPORT void opus_decoder_destroy(OpusDecoder *st); + +/** Parse an opus packet into one or more frames. + * Opus_decode will perform this operation internally so most applications do + * not need to use this function. + * This function does not copy the frames, the returned pointers are pointers into + * the input packet. + * @param [in] data char*: Opus packet to be parsed + * @param [in] len opus_int32: size of data + * @param [out] out_toc char*: TOC pointer + * @param [out] frames char*[48] encapsulated frames + * @param [out] size opus_int16[48] sizes of the encapsulated frames + * @param [out] payload_offset int*: returns the position of the payload within the packet (in bytes) + * @returns number of frames + */ +OPUS_EXPORT int opus_packet_parse( + const unsigned char *data, + opus_int32 len, + unsigned char *out_toc, + const unsigned char *frames[48], + opus_int16 size[48], + int *payload_offset +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Gets the bandwidth of an Opus packet. + * @param [in] data char*: Opus packet + * @retval OPUS_BANDWIDTH_NARROWBAND Narrowband (4kHz bandpass) + * @retval OPUS_BANDWIDTH_MEDIUMBAND Mediumband (6kHz bandpass) + * @retval OPUS_BANDWIDTH_WIDEBAND Wideband (8kHz bandpass) + * @retval OPUS_BANDWIDTH_SUPERWIDEBAND Superwideband (12kHz bandpass) + * @retval OPUS_BANDWIDTH_FULLBAND Fullband (20kHz bandpass) + * @retval OPUS_INVALID_PACKET The compressed data passed is corrupted or of an unsupported type + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_packet_get_bandwidth(const unsigned char *data) OPUS_ARG_NONNULL(1); + +/** Gets the number of samples per frame from an Opus packet. + * @param [in] data char*: Opus packet. + * This must contain at least one byte of + * data. + * @param [in] Fs opus_int32: Sampling rate in Hz. + * This must be a multiple of 400, or + * inaccurate results will be returned. + * @returns Number of samples per frame. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_packet_get_samples_per_frame(const unsigned char *data, opus_int32 Fs) OPUS_ARG_NONNULL(1); + +/** Gets the number of channels from an Opus packet. + * @param [in] data char*: Opus packet + * @returns Number of channels + * @retval OPUS_INVALID_PACKET The compressed data passed is corrupted or of an unsupported type + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_packet_get_nb_channels(const unsigned char *data) OPUS_ARG_NONNULL(1); + +/** Gets the number of frames in an Opus packet. + * @param [in] packet char*: Opus packet + * @param [in] len opus_int32: Length of packet + * @returns Number of frames + * @retval OPUS_BAD_ARG Insufficient data was passed to the function + * @retval OPUS_INVALID_PACKET The compressed data passed is corrupted or of an unsupported type + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_packet_get_nb_frames(const unsigned char packet[], opus_int32 len) OPUS_ARG_NONNULL(1); + +/** Gets the number of samples of an Opus packet. + * @param [in] packet char*: Opus packet + * @param [in] len opus_int32: Length of packet + * @param [in] Fs opus_int32: Sampling rate in Hz. + * This must be a multiple of 400, or + * inaccurate results will be returned. + * @returns Number of samples + * @retval OPUS_BAD_ARG Insufficient data was passed to the function + * @retval OPUS_INVALID_PACKET The compressed data passed is corrupted or of an unsupported type + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_packet_get_nb_samples(const unsigned char packet[], opus_int32 len, opus_int32 Fs) OPUS_ARG_NONNULL(1); + +/** Gets the number of samples of an Opus packet. + * @param [in] dec OpusDecoder*: Decoder state + * @param [in] packet char*: Opus packet + * @param [in] len opus_int32: Length of packet + * @returns Number of samples + * @retval OPUS_BAD_ARG Insufficient data was passed to the function + * @retval OPUS_INVALID_PACKET The compressed data passed is corrupted or of an unsupported type + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_decoder_get_nb_samples(const OpusDecoder *dec, const unsigned char packet[], opus_int32 len) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2); +/**@}*/ + +/** @defgroup opus_repacketizer Repacketizer + * @{ + * + * The repacketizer can be used to merge multiple Opus packets into a single + * packet or alternatively to split Opus packets that have previously been + * merged. Splitting valid Opus packets is always guaranteed to succeed, + * whereas merging valid packets only succeeds if all frames have the same + * mode, bandwidth, and frame size, and when the total duration of the merged + * packet is no more than 120 ms. + * The repacketizer currently only operates on elementary Opus + * streams. It will not manipualte multistream packets successfully, except in + * the degenerate case where they consist of data from a single stream. + * + * The repacketizing process starts with creating a repacketizer state, either + * by calling opus_repacketizer_create() or by allocating the memory yourself, + * e.g., + * @code + * OpusRepacketizer *rp; + * rp = (OpusRepacketizer*)malloc(opus_repacketizer_get_size()); + * if (rp != NULL) + * opus_repacketizer_init(rp); + * @endcode + * + * Then the application should submit packets with opus_repacketizer_cat(), + * extract new packets with opus_repacketizer_out() or + * opus_repacketizer_out_range(), and then reset the state for the next set of + * input packets via opus_repacketizer_init(). + * + * For example, to split a sequence of packets into individual frames: + * @code + * unsigned char *data; + * int len; + * while (get_next_packet(&data, &len)) + * { + * unsigned char out[1276]; + * opus_int32 out_len; + * int nb_frames; + * int err; + * int i; + * err = opus_repacketizer_cat(rp, data, len); + * if (err != OPUS_OK) + * { + * release_packet(data); + * return err; + * } + * nb_frames = opus_repacketizer_get_nb_frames(rp); + * for (i = 0; i < nb_frames; i++) + * { + * out_len = opus_repacketizer_out_range(rp, i, i+1, out, sizeof(out)); + * if (out_len < 0) + * { + * release_packet(data); + * return (int)out_len; + * } + * output_next_packet(out, out_len); + * } + * opus_repacketizer_init(rp); + * release_packet(data); + * } + * @endcode + * + * Alternatively, to combine a sequence of frames into packets that each + * contain up to TARGET_DURATION_MS milliseconds of data: + * @code + * // The maximum number of packets with duration TARGET_DURATION_MS occurs + * // when the frame size is 2.5 ms, for a total of (TARGET_DURATION_MS*2/5) + * // packets. + * unsigned char *data[(TARGET_DURATION_MS*2/5)+1]; + * opus_int32 len[(TARGET_DURATION_MS*2/5)+1]; + * int nb_packets; + * unsigned char out[1277*(TARGET_DURATION_MS*2/2)]; + * opus_int32 out_len; + * int prev_toc; + * nb_packets = 0; + * while (get_next_packet(data+nb_packets, len+nb_packets)) + * { + * int nb_frames; + * int err; + * nb_frames = opus_packet_get_nb_frames(data[nb_packets], len[nb_packets]); + * if (nb_frames < 1) + * { + * release_packets(data, nb_packets+1); + * return nb_frames; + * } + * nb_frames += opus_repacketizer_get_nb_frames(rp); + * // If adding the next packet would exceed our target, or it has an + * // incompatible TOC sequence, output the packets we already have before + * // submitting it. + * // N.B., The nb_packets > 0 check ensures we've submitted at least one + * // packet since the last call to opus_repacketizer_init(). Otherwise a + * // single packet longer than TARGET_DURATION_MS would cause us to try to + * // output an (invalid) empty packet. It also ensures that prev_toc has + * // been set to a valid value. Additionally, len[nb_packets] > 0 is + * // guaranteed by the call to opus_packet_get_nb_frames() above, so the + * // reference to data[nb_packets][0] should be valid. + * if (nb_packets > 0 && ( + * ((prev_toc & 0xFC) != (data[nb_packets][0] & 0xFC)) || + * opus_packet_get_samples_per_frame(data[nb_packets], 48000)*nb_frames > + * TARGET_DURATION_MS*48)) + * { + * out_len = opus_repacketizer_out(rp, out, sizeof(out)); + * if (out_len < 0) + * { + * release_packets(data, nb_packets+1); + * return (int)out_len; + * } + * output_next_packet(out, out_len); + * opus_repacketizer_init(rp); + * release_packets(data, nb_packets); + * data[0] = data[nb_packets]; + * len[0] = len[nb_packets]; + * nb_packets = 0; + * } + * err = opus_repacketizer_cat(rp, data[nb_packets], len[nb_packets]); + * if (err != OPUS_OK) + * { + * release_packets(data, nb_packets+1); + * return err; + * } + * prev_toc = data[nb_packets][0]; + * nb_packets++; + * } + * // Output the final, partial packet. + * if (nb_packets > 0) + * { + * out_len = opus_repacketizer_out(rp, out, sizeof(out)); + * release_packets(data, nb_packets); + * if (out_len < 0) + * return (int)out_len; + * output_next_packet(out, out_len); + * } + * @endcode + * + * An alternate way of merging packets is to simply call opus_repacketizer_cat() + * unconditionally until it fails. At that point, the merged packet can be + * obtained with opus_repacketizer_out() and the input packet for which + * opus_repacketizer_cat() needs to be re-added to a newly reinitialized + * repacketizer state. + */ + +typedef struct OpusRepacketizer OpusRepacketizer; + +/** Gets the size of an OpusRepacketizer structure. + * @returns The size in bytes. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_repacketizer_get_size(void); + +/** (Re)initializes a previously allocated repacketizer state. + * The state must be at least the size returned by opus_repacketizer_get_size(). + * This can be used for applications which use their own allocator instead of + * malloc(). + * It must also be called to reset the queue of packets waiting to be + * repacketized, which is necessary if the maximum packet duration of 120 ms + * is reached or if you wish to submit packets with a different Opus + * configuration (coding mode, audio bandwidth, frame size, or channel count). + * Failure to do so will prevent a new packet from being added with + * opus_repacketizer_cat(). + * @see opus_repacketizer_create + * @see opus_repacketizer_get_size + * @see opus_repacketizer_cat + * @param rp OpusRepacketizer*: The repacketizer state to + * (re)initialize. + * @returns A pointer to the same repacketizer state that was passed in. + */ +OPUS_EXPORT OpusRepacketizer *opus_repacketizer_init(OpusRepacketizer *rp) OPUS_ARG_NONNULL(1); + +/** Allocates memory and initializes the new repacketizer with + * opus_repacketizer_init(). + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT OpusRepacketizer *opus_repacketizer_create(void); + +/** Frees an OpusRepacketizer allocated by + * opus_repacketizer_create(). + * @param[in] rp OpusRepacketizer*: State to be freed. + */ +OPUS_EXPORT void opus_repacketizer_destroy(OpusRepacketizer *rp); + +/** Add a packet to the current repacketizer state. + * This packet must match the configuration of any packets already submitted + * for repacketization since the last call to opus_repacketizer_init(). + * This means that it must have the same coding mode, audio bandwidth, frame + * size, and channel count. + * This can be checked in advance by examining the top 6 bits of the first + * byte of the packet, and ensuring they match the top 6 bits of the first + * byte of any previously submitted packet. + * The total duration of audio in the repacketizer state also must not exceed + * 120 ms, the maximum duration of a single packet, after adding this packet. + * + * The contents of the current repacketizer state can be extracted into new + * packets using opus_repacketizer_out() or opus_repacketizer_out_range(). + * + * In order to add a packet with a different configuration or to add more + * audio beyond 120 ms, you must clear the repacketizer state by calling + * opus_repacketizer_init(). + * If a packet is too large to add to the current repacketizer state, no part + * of it is added, even if it contains multiple frames, some of which might + * fit. + * If you wish to be able to add parts of such packets, you should first use + * another repacketizer to split the packet into pieces and add them + * individually. + * @see opus_repacketizer_out_range + * @see opus_repacketizer_out + * @see opus_repacketizer_init + * @param rp OpusRepacketizer*: The repacketizer state to which to + * add the packet. + * @param[in] data const unsigned char*: The packet data. + * The application must ensure + * this pointer remains valid + * until the next call to + * opus_repacketizer_init() or + * opus_repacketizer_destroy(). + * @param len opus_int32: The number of bytes in the packet data. + * @returns An error code indicating whether or not the operation succeeded. + * @retval #OPUS_OK The packet's contents have been added to the repacketizer + * state. + * @retval #OPUS_INVALID_PACKET The packet did not have a valid TOC sequence, + * the packet's TOC sequence was not compatible + * with previously submitted packets (because + * the coding mode, audio bandwidth, frame size, + * or channel count did not match), or adding + * this packet would increase the total amount of + * audio stored in the repacketizer state to more + * than 120 ms. + */ +OPUS_EXPORT int opus_repacketizer_cat(OpusRepacketizer *rp, const unsigned char *data, opus_int32 len) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2); + + +/** Construct a new packet from data previously submitted to the repacketizer + * state via opus_repacketizer_cat(). + * @param rp OpusRepacketizer*: The repacketizer state from which to + * construct the new packet. + * @param begin int: The index of the first frame in the current + * repacketizer state to include in the output. + * @param end int: One past the index of the last frame in the + * current repacketizer state to include in the + * output. + * @param[out] data const unsigned char*: The buffer in which to + * store the output packet. + * @param maxlen opus_int32: The maximum number of bytes to store in + * the output buffer. In order to guarantee + * success, this should be at least + * 1276 for a single frame, + * or for multiple frames, + * 1277*(end-begin). + * However, 1*(end-begin) plus + * the size of all packet data submitted to + * the repacketizer since the last call to + * opus_repacketizer_init() or + * opus_repacketizer_create() is also + * sufficient, and possibly much smaller. + * @returns The total size of the output packet on success, or an error code + * on failure. + * @retval #OPUS_BAD_ARG [begin,end) was an invalid range of + * frames (begin < 0, begin >= end, or end > + * opus_repacketizer_get_nb_frames()). + * @retval #OPUS_BUFFER_TOO_SMALL \a maxlen was insufficient to contain the + * complete output packet. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_repacketizer_out_range(OpusRepacketizer *rp, int begin, int end, unsigned char *data, opus_int32 maxlen) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Return the total number of frames contained in packet data submitted to + * the repacketizer state so far via opus_repacketizer_cat() since the last + * call to opus_repacketizer_init() or opus_repacketizer_create(). + * This defines the valid range of packets that can be extracted with + * opus_repacketizer_out_range() or opus_repacketizer_out(). + * @param rp OpusRepacketizer*: The repacketizer state containing the + * frames. + * @returns The total number of frames contained in the packet data submitted + * to the repacketizer state. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_repacketizer_get_nb_frames(OpusRepacketizer *rp) OPUS_ARG_NONNULL(1); + +/** Construct a new packet from data previously submitted to the repacketizer + * state via opus_repacketizer_cat(). + * This is a convenience routine that returns all the data submitted so far + * in a single packet. + * It is equivalent to calling + * @code + * opus_repacketizer_out_range(rp, 0, opus_repacketizer_get_nb_frames(rp), + * data, maxlen) + * @endcode + * @param rp OpusRepacketizer*: The repacketizer state from which to + * construct the new packet. + * @param[out] data const unsigned char*: The buffer in which to + * store the output packet. + * @param maxlen opus_int32: The maximum number of bytes to store in + * the output buffer. In order to guarantee + * success, this should be at least + * 1277*opus_repacketizer_get_nb_frames(rp). + * However, + * 1*opus_repacketizer_get_nb_frames(rp) + * plus the size of all packet data + * submitted to the repacketizer since the + * last call to opus_repacketizer_init() or + * opus_repacketizer_create() is also + * sufficient, and possibly much smaller. + * @returns The total size of the output packet on success, or an error code + * on failure. + * @retval #OPUS_BUFFER_TOO_SMALL \a maxlen was insufficient to contain the + * complete output packet. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_repacketizer_out(OpusRepacketizer *rp, unsigned char *data, opus_int32 maxlen) OPUS_ARG_NONNULL(1); + +/**@}*/ + +#ifdef __cplusplus +} +#endif + +#endif /* OPUS_H */ diff --git a/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_custom.h b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_custom.h new file mode 100644 index 0000000..e7861d6 --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_custom.h @@ -0,0 +1,329 @@ +/* Copyright (c) 2007-2008 CSIRO + Copyright (c) 2007-2009 Xiph.Org Foundation + Copyright (c) 2008-2012 Gregory Maxwell + Written by Jean-Marc Valin and Gregory Maxwell */ +/* + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + - Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + - Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER + OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF + LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/** + @file opus_custom.h + @brief Opus-Custom reference implementation API + */ + +#ifndef OPUS_CUSTOM_H +#define OPUS_CUSTOM_H + +#include "opus_defines.h" + +#ifdef __cplusplus +extern "C" { +#endif + +#ifdef CUSTOM_MODES +#define OPUS_CUSTOM_EXPORT OPUS_EXPORT +#define OPUS_CUSTOM_EXPORT_STATIC OPUS_EXPORT +#else +#define OPUS_CUSTOM_EXPORT +#ifdef CELT_C +#define OPUS_CUSTOM_EXPORT_STATIC static inline +#else +#define OPUS_CUSTOM_EXPORT_STATIC +#endif +#endif + +/** @defgroup opus_custom Opus Custom + * @{ + * Opus Custom is an optional part of the Opus specification and + * reference implementation which uses a distinct API from the regular + * API and supports frame sizes that are not normally supported.\ Use + * of Opus Custom is discouraged for all but very special applications + * for which a frame size different from 2.5, 5, 10, or 20 ms is needed + * (for either complexity or latency reasons) and where interoperability + * is less important. + * + * In addition to the interoperability limitations the use of Opus custom + * disables a substantial chunk of the codec and generally lowers the + * quality available at a given bitrate. Normally when an application needs + * a different frame size from the codec it should buffer to match the + * sizes but this adds a small amount of delay which may be important + * in some very low latency applications. Some transports (especially + * constant rate RF transports) may also work best with frames of + * particular durations. + * + * Libopus only supports custom modes if they are enabled at compile time. + * + * The Opus Custom API is similar to the regular API but the + * @ref opus_encoder_create and @ref opus_decoder_create calls take + * an additional mode parameter which is a structure produced by + * a call to @ref opus_custom_mode_create. Both the encoder and decoder + * must create a mode using the same sample rate (fs) and frame size + * (frame size) so these parameters must either be signaled out of band + * or fixed in a particular implementation. + * + * Similar to regular Opus the custom modes support on the fly frame size + * switching, but the sizes available depend on the particular frame size in + * use. For some initial frame sizes on a single on the fly size is available. + */ + +/** Contains the state of an encoder. One encoder state is needed + for each stream. It is initialized once at the beginning of the + stream. Do *not* re-initialize the state for every frame. + @brief Encoder state + */ +typedef struct OpusCustomEncoder OpusCustomEncoder; + +/** State of the decoder. One decoder state is needed for each stream. + It is initialized once at the beginning of the stream. Do *not* + re-initialize the state for every frame. + @brief Decoder state + */ +typedef struct OpusCustomDecoder OpusCustomDecoder; + +/** The mode contains all the information necessary to create an + encoder. Both the encoder and decoder need to be initialized + with exactly the same mode, otherwise the output will be + corrupted. + @brief Mode configuration + */ +typedef struct OpusCustomMode OpusCustomMode; + +/** Creates a new mode struct. This will be passed to an encoder or + * decoder. The mode MUST NOT BE DESTROYED until the encoders and + * decoders that use it are destroyed as well. + * @param [in] Fs int: Sampling rate (8000 to 96000 Hz) + * @param [in] frame_size int: Number of samples (per channel) to encode in each + * packet (64 - 1024, prime factorization must contain zero or more 2s, 3s, or 5s and no other primes) + * @param [out] error int*: Returned error code (if NULL, no error will be returned) + * @return A newly created mode + */ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT OpusCustomMode *opus_custom_mode_create(opus_int32 Fs, int frame_size, int *error); + +/** Destroys a mode struct. Only call this after all encoders and + * decoders using this mode are destroyed as well. + * @param [in] mode OpusCustomMode*: Mode to be freed. + */ +OPUS_CUSTOM_EXPORT void opus_custom_mode_destroy(OpusCustomMode *mode); + +/* Encoder */ +/** Gets the size of an OpusCustomEncoder structure. + * @param [in] mode OpusCustomMode *: Mode configuration + * @param [in] channels int: Number of channels + * @returns size + */ +OPUS_CUSTOM_EXPORT_STATIC OPUS_WARN_UNUSED_RESULT int opus_custom_encoder_get_size( + const OpusCustomMode *mode, + int channels +) OPUS_ARG_NONNULL(1); + +/** Creates a new encoder state. Each stream needs its own encoder + * state (can't be shared across simultaneous streams). + * @param [in] mode OpusCustomMode*: Contains all the information about the characteristics of + * the stream (must be the same characteristics as used for the + * decoder) + * @param [in] channels int: Number of channels + * @param [out] error int*: Returns an error code + * @return Newly created encoder state. +*/ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT OpusCustomEncoder *opus_custom_encoder_create( + const OpusCustomMode *mode, + int channels, + int *error +) OPUS_ARG_NONNULL(1); + +/** Initializes a previously allocated encoder state + * The memory pointed to by st must be the size returned by opus_custom_encoder_get_size. + * This is intended for applications which use their own allocator instead of malloc. + * @see opus_custom_encoder_create(),opus_custom_encoder_get_size() + * To reset a previously initialized state use the OPUS_RESET_STATE CTL. + * @param [in] st OpusCustomEncoder*: Encoder state + * @param [in] mode OpusCustomMode *: Contains all the information about the characteristics of + * the stream (must be the same characteristics as used for the + * decoder) + * @param [in] channels int: Number of channels + * @return OPUS_OK Success or @ref opus_errorcodes + */ +OPUS_CUSTOM_EXPORT_STATIC int opus_custom_encoder_init( + OpusCustomEncoder *st, + const OpusCustomMode *mode, + int channels +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2); + +/** Destroys a an encoder state. + * @param[in] st OpusCustomEncoder*: State to be freed. + */ +OPUS_CUSTOM_EXPORT void opus_custom_encoder_destroy(OpusCustomEncoder *st); + +/** Encodes a frame of audio. + * @param [in] st OpusCustomEncoder*: Encoder state + * @param [in] pcm float*: PCM audio in float format, with a normal range of +/-1.0. + * Samples with a range beyond +/-1.0 are supported but will + * be clipped by decoders using the integer API and should + * only be used if it is known that the far end supports + * extended dynamic range. There must be exactly + * frame_size samples per channel. + * @param [in] frame_size int: Number of samples per frame of input signal + * @param [out] compressed char *: The compressed data is written here. This may not alias pcm and must be at least maxCompressedBytes long. + * @param [in] maxCompressedBytes int: Maximum number of bytes to use for compressing the frame + * (can change from one frame to another) + * @return Number of bytes written to "compressed". + * If negative, an error has occurred (see error codes). It is IMPORTANT that + * the length returned be somehow transmitted to the decoder. Otherwise, no + * decoding is possible. + */ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT int opus_custom_encode_float( + OpusCustomEncoder *st, + const float *pcm, + int frame_size, + unsigned char *compressed, + int maxCompressedBytes +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2) OPUS_ARG_NONNULL(4); + +/** Encodes a frame of audio. + * @param [in] st OpusCustomEncoder*: Encoder state + * @param [in] pcm opus_int16*: PCM audio in signed 16-bit format (native endian). + * There must be exactly frame_size samples per channel. + * @param [in] frame_size int: Number of samples per frame of input signal + * @param [out] compressed char *: The compressed data is written here. This may not alias pcm and must be at least maxCompressedBytes long. + * @param [in] maxCompressedBytes int: Maximum number of bytes to use for compressing the frame + * (can change from one frame to another) + * @return Number of bytes written to "compressed". + * If negative, an error has occurred (see error codes). It is IMPORTANT that + * the length returned be somehow transmitted to the decoder. Otherwise, no + * decoding is possible. + */ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT int opus_custom_encode( + OpusCustomEncoder *st, + const opus_int16 *pcm, + int frame_size, + unsigned char *compressed, + int maxCompressedBytes +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2) OPUS_ARG_NONNULL(4); + +/** Perform a CTL function on an Opus custom encoder. + * + * Generally the request and subsequent arguments are generated + * by a convenience macro. + * @see opus_encoderctls + */ +OPUS_CUSTOM_EXPORT int opus_custom_encoder_ctl(OpusCustomEncoder * OPUS_RESTRICT st, int request, ...) OPUS_ARG_NONNULL(1); + +/* Decoder */ + +/** Gets the size of an OpusCustomDecoder structure. + * @param [in] mode OpusCustomMode *: Mode configuration + * @param [in] channels int: Number of channels + * @returns size + */ +OPUS_CUSTOM_EXPORT_STATIC OPUS_WARN_UNUSED_RESULT int opus_custom_decoder_get_size( + const OpusCustomMode *mode, + int channels +) OPUS_ARG_NONNULL(1); + +/** Creates a new decoder state. Each stream needs its own decoder state (can't + * be shared across simultaneous streams). + * @param [in] mode OpusCustomMode: Contains all the information about the characteristics of the + * stream (must be the same characteristics as used for the encoder) + * @param [in] channels int: Number of channels + * @param [out] error int*: Returns an error code + * @return Newly created decoder state. + */ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT OpusCustomDecoder *opus_custom_decoder_create( + const OpusCustomMode *mode, + int channels, + int *error +) OPUS_ARG_NONNULL(1); + +/** Initializes a previously allocated decoder state + * The memory pointed to by st must be the size returned by opus_custom_decoder_get_size. + * This is intended for applications which use their own allocator instead of malloc. + * @see opus_custom_decoder_create(),opus_custom_decoder_get_size() + * To reset a previously initialized state use the OPUS_RESET_STATE CTL. + * @param [in] st OpusCustomDecoder*: Decoder state + * @param [in] mode OpusCustomMode *: Contains all the information about the characteristics of + * the stream (must be the same characteristics as used for the + * encoder) + * @param [in] channels int: Number of channels + * @return OPUS_OK Success or @ref opus_errorcodes + */ +OPUS_CUSTOM_EXPORT_STATIC int opus_custom_decoder_init( + OpusCustomDecoder *st, + const OpusCustomMode *mode, + int channels +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2); + +/** Destroys a an decoder state. + * @param[in] st OpusCustomDecoder*: State to be freed. + */ +OPUS_CUSTOM_EXPORT void opus_custom_decoder_destroy(OpusCustomDecoder *st); + +/** Decode an opus custom frame with floating point output + * @param [in] st OpusCustomDecoder*: Decoder state + * @param [in] data char*: Input payload. Use a NULL pointer to indicate packet loss + * @param [in] len int: Number of bytes in payload + * @param [out] pcm float*: Output signal (interleaved if 2 channels). length + * is frame_size*channels*sizeof(float) + * @param [in] frame_size Number of samples per channel of available space in *pcm. + * @returns Number of decoded samples or @ref opus_errorcodes + */ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT int opus_custom_decode_float( + OpusCustomDecoder *st, + const unsigned char *data, + int len, + float *pcm, + int frame_size +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Decode an opus custom frame + * @param [in] st OpusCustomDecoder*: Decoder state + * @param [in] data char*: Input payload. Use a NULL pointer to indicate packet loss + * @param [in] len int: Number of bytes in payload + * @param [out] pcm opus_int16*: Output signal (interleaved if 2 channels). length + * is frame_size*channels*sizeof(opus_int16) + * @param [in] frame_size Number of samples per channel of available space in *pcm. + * @returns Number of decoded samples or @ref opus_errorcodes + */ +OPUS_CUSTOM_EXPORT OPUS_WARN_UNUSED_RESULT int opus_custom_decode( + OpusCustomDecoder *st, + const unsigned char *data, + int len, + opus_int16 *pcm, + int frame_size +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Perform a CTL function on an Opus custom decoder. + * + * Generally the request and subsequent arguments are generated + * by a convenience macro. + * @see opus_genericctls + */ +OPUS_CUSTOM_EXPORT int opus_custom_decoder_ctl(OpusCustomDecoder * OPUS_RESTRICT st, int request, ...) OPUS_ARG_NONNULL(1); + +/**@}*/ + +#ifdef __cplusplus +} +#endif + +#endif /* OPUS_CUSTOM_H */ diff --git a/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_defines.h b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_defines.h new file mode 100644 index 0000000..9fa3ccb --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_defines.h @@ -0,0 +1,655 @@ +/* Copyright (c) 2010-2011 Xiph.Org Foundation, Skype Limited + Written by Jean-Marc Valin and Koen Vos */ +/* + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + - Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + - Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER + OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF + LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/** + * @file opus_defines.h + * @brief Opus reference implementation constants + */ + +#ifndef OPUS_DEFINES_H +#define OPUS_DEFINES_H + +#include "opus_types.h" + +#ifdef __cplusplus +extern "C" { +#endif + +/** @defgroup opus_errorcodes Error codes + * @{ + */ +/** No error @hideinitializer*/ +#define OPUS_OK 0 +/** One or more invalid/out of range arguments @hideinitializer*/ +#define OPUS_BAD_ARG -1 +/** The mode struct passed is invalid @hideinitializer*/ +#define OPUS_BUFFER_TOO_SMALL -2 +/** An internal error was detected @hideinitializer*/ +#define OPUS_INTERNAL_ERROR -3 +/** The compressed data passed is corrupted @hideinitializer*/ +#define OPUS_INVALID_PACKET -4 +/** Invalid/unsupported request number @hideinitializer*/ +#define OPUS_UNIMPLEMENTED -5 +/** An encoder or decoder structure is invalid or already freed @hideinitializer*/ +#define OPUS_INVALID_STATE -6 +/** Memory allocation has failed @hideinitializer*/ +#define OPUS_ALLOC_FAIL -7 +/**@}*/ + +/** @cond OPUS_INTERNAL_DOC */ +/**Export control for opus functions */ + +#ifndef OPUS_EXPORT +# if defined(WIN32) +# ifdef OPUS_BUILD +# define OPUS_EXPORT __declspec(dllexport) +# else +# define OPUS_EXPORT +# endif +# elif defined(__GNUC__) && defined(OPUS_BUILD) +# define OPUS_EXPORT __attribute__ ((visibility ("default"))) +# else +# define OPUS_EXPORT +# endif +#endif + +# if !defined(OPUS_GNUC_PREREQ) +# if defined(__GNUC__)&&defined(__GNUC_MINOR__) +# define OPUS_GNUC_PREREQ(_maj,_min) \ + ((__GNUC__<<16)+__GNUC_MINOR__>=((_maj)<<16)+(_min)) +# else +# define OPUS_GNUC_PREREQ(_maj,_min) 0 +# endif +# endif + +#if (!defined(__STDC_VERSION__) || (__STDC_VERSION__ < 199901L) ) +# if OPUS_GNUC_PREREQ(3,0) +# define OPUS_RESTRICT __restrict__ +# elif (defined(_MSC_VER) && _MSC_VER >= 1400) +# define OPUS_RESTRICT __restrict +# else +# define OPUS_RESTRICT +# endif +#else +# define OPUS_RESTRICT restrict +#endif + +/**Warning attributes for opus functions + * NONNULL is not used in OPUS_BUILD to avoid the compiler optimizing out + * some paranoid null checks. */ +#if defined(__GNUC__) && OPUS_GNUC_PREREQ(3, 4) +# define OPUS_WARN_UNUSED_RESULT __attribute__ ((__warn_unused_result__)) +#else +# define OPUS_WARN_UNUSED_RESULT +#endif +#if !defined(OPUS_BUILD) && defined(__GNUC__) && OPUS_GNUC_PREREQ(3, 4) +# define OPUS_ARG_NONNULL(_x) __attribute__ ((__nonnull__(_x))) +#else +# define OPUS_ARG_NONNULL(_x) +#endif + +/** These are the actual Encoder CTL ID numbers. + * They should not be used directly by applications. + * In general, SETs should be even and GETs should be odd.*/ +#define OPUS_SET_APPLICATION_REQUEST 4000 +#define OPUS_GET_APPLICATION_REQUEST 4001 +#define OPUS_SET_BITRATE_REQUEST 4002 +#define OPUS_GET_BITRATE_REQUEST 4003 +#define OPUS_SET_MAX_BANDWIDTH_REQUEST 4004 +#define OPUS_GET_MAX_BANDWIDTH_REQUEST 4005 +#define OPUS_SET_VBR_REQUEST 4006 +#define OPUS_GET_VBR_REQUEST 4007 +#define OPUS_SET_BANDWIDTH_REQUEST 4008 +#define OPUS_GET_BANDWIDTH_REQUEST 4009 +#define OPUS_SET_COMPLEXITY_REQUEST 4010 +#define OPUS_GET_COMPLEXITY_REQUEST 4011 +#define OPUS_SET_INBAND_FEC_REQUEST 4012 +#define OPUS_GET_INBAND_FEC_REQUEST 4013 +#define OPUS_SET_PACKET_LOSS_PERC_REQUEST 4014 +#define OPUS_GET_PACKET_LOSS_PERC_REQUEST 4015 +#define OPUS_SET_DTX_REQUEST 4016 +#define OPUS_GET_DTX_REQUEST 4017 +#define OPUS_SET_VBR_CONSTRAINT_REQUEST 4020 +#define OPUS_GET_VBR_CONSTRAINT_REQUEST 4021 +#define OPUS_SET_FORCE_CHANNELS_REQUEST 4022 +#define OPUS_GET_FORCE_CHANNELS_REQUEST 4023 +#define OPUS_SET_SIGNAL_REQUEST 4024 +#define OPUS_GET_SIGNAL_REQUEST 4025 +#define OPUS_GET_LOOKAHEAD_REQUEST 4027 +/* #define OPUS_RESET_STATE 4028 */ +#define OPUS_GET_SAMPLE_RATE_REQUEST 4029 +#define OPUS_GET_FINAL_RANGE_REQUEST 4031 +#define OPUS_GET_PITCH_REQUEST 4033 +#define OPUS_SET_GAIN_REQUEST 4034 +#define OPUS_GET_GAIN_REQUEST 4045 /* Should have been 4035 */ +#define OPUS_SET_LSB_DEPTH_REQUEST 4036 +#define OPUS_GET_LSB_DEPTH_REQUEST 4037 + +#define OPUS_GET_LAST_PACKET_DURATION_REQUEST 4039 + +/* Don't use 4045, it's already taken by OPUS_GET_GAIN_REQUEST */ + +/* Macros to trigger compilation errors when the wrong types are provided to a CTL */ +#define __opus_check_int(x) (((void)((x) == (opus_int32)0)), (opus_int32)(x)) +#define __opus_check_int_ptr(ptr) ((ptr) + ((ptr) - (opus_int32*)(ptr))) +#define __opus_check_uint_ptr(ptr) ((ptr) + ((ptr) - (opus_uint32*)(ptr))) +/** @endcond */ + +/** @defgroup opus_ctlvalues Pre-defined values for CTL interface + * @see opus_genericctls, opus_encoderctls + * @{ + */ +/* Values for the various encoder CTLs */ +#define OPUS_AUTO -1000 /**opus_int32: Allowed values: 0-10, inclusive. + * + * @hideinitializer */ +#define OPUS_SET_COMPLEXITY(x) OPUS_SET_COMPLEXITY_REQUEST, __opus_check_int(x) +/** Gets the encoder's complexity configuration. + * @see OPUS_SET_COMPLEXITY + * @param[out] x opus_int32 *: Returns a value in the range 0-10, + * inclusive. + * @hideinitializer */ +#define OPUS_GET_COMPLEXITY(x) OPUS_GET_COMPLEXITY_REQUEST, __opus_check_int_ptr(x) + +/** Configures the bitrate in the encoder. + * Rates from 500 to 512000 bits per second are meaningful, as well as the + * special values #OPUS_AUTO and #OPUS_BITRATE_MAX. + * The value #OPUS_BITRATE_MAX can be used to cause the codec to use as much + * rate as it can, which is useful for controlling the rate by adjusting the + * output buffer size. + * @see OPUS_GET_BITRATE + * @param[in] x opus_int32: Bitrate in bits per second. The default + * is determined based on the number of + * channels and the input sampling rate. + * @hideinitializer */ +#define OPUS_SET_BITRATE(x) OPUS_SET_BITRATE_REQUEST, __opus_check_int(x) +/** Gets the encoder's bitrate configuration. + * @see OPUS_SET_BITRATE + * @param[out] x opus_int32 *: Returns the bitrate in bits per second. + * The default is determined based on the + * number of channels and the input + * sampling rate. + * @hideinitializer */ +#define OPUS_GET_BITRATE(x) OPUS_GET_BITRATE_REQUEST, __opus_check_int_ptr(x) + +/** Enables or disables variable bitrate (VBR) in the encoder. + * The configured bitrate may not be met exactly because frames must + * be an integer number of bytes in length. + * @warning Only the MDCT mode of Opus can provide hard CBR behavior. + * @see OPUS_GET_VBR + * @see OPUS_SET_VBR_CONSTRAINT + * @param[in] x opus_int32: Allowed values: + *
+ *
0
Hard CBR. For LPC/hybrid modes at very low bit-rate, this can + * cause noticeable quality degradation.
+ *
1
VBR (default). The exact type of VBR is controlled by + * #OPUS_SET_VBR_CONSTRAINT.
+ *
+ * @hideinitializer */ +#define OPUS_SET_VBR(x) OPUS_SET_VBR_REQUEST, __opus_check_int(x) +/** Determine if variable bitrate (VBR) is enabled in the encoder. + * @see OPUS_SET_VBR + * @see OPUS_GET_VBR_CONSTRAINT + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
0
Hard CBR.
+ *
1
VBR (default). The exact type of VBR may be retrieved via + * #OPUS_GET_VBR_CONSTRAINT.
+ *
+ * @hideinitializer */ +#define OPUS_GET_VBR(x) OPUS_GET_VBR_REQUEST, __opus_check_int_ptr(x) + +/** Enables or disables constrained VBR in the encoder. + * This setting is ignored when the encoder is in CBR mode. + * @warning Only the MDCT mode of Opus currently heeds the constraint. + * Speech mode ignores it completely, hybrid mode may fail to obey it + * if the LPC layer uses more bitrate than the constraint would have + * permitted. + * @see OPUS_GET_VBR_CONSTRAINT + * @see OPUS_SET_VBR + * @param[in] x opus_int32: Allowed values: + *
+ *
0
Unconstrained VBR.
+ *
1
Constrained VBR (default). This creates a maximum of one + * frame of buffering delay assuming a transport with a + * serialization speed of the nominal bitrate.
+ *
+ * @hideinitializer */ +#define OPUS_SET_VBR_CONSTRAINT(x) OPUS_SET_VBR_CONSTRAINT_REQUEST, __opus_check_int(x) +/** Determine if constrained VBR is enabled in the encoder. + * @see OPUS_SET_VBR_CONSTRAINT + * @see OPUS_GET_VBR + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
0
Unconstrained VBR.
+ *
1
Constrained VBR (default).
+ *
+ * @hideinitializer */ +#define OPUS_GET_VBR_CONSTRAINT(x) OPUS_GET_VBR_CONSTRAINT_REQUEST, __opus_check_int_ptr(x) + +/** Configures mono/stereo forcing in the encoder. + * This can force the encoder to produce packets encoded as either mono or + * stereo, regardless of the format of the input audio. This is useful when + * the caller knows that the input signal is currently a mono source embedded + * in a stereo stream. + * @see OPUS_GET_FORCE_CHANNELS + * @param[in] x opus_int32: Allowed values: + *
+ *
#OPUS_AUTO
Not forced (default)
+ *
1
Forced mono
+ *
2
Forced stereo
+ *
+ * @hideinitializer */ +#define OPUS_SET_FORCE_CHANNELS(x) OPUS_SET_FORCE_CHANNELS_REQUEST, __opus_check_int(x) +/** Gets the encoder's forced channel configuration. + * @see OPUS_SET_FORCE_CHANNELS + * @param[out] x opus_int32 *: + *
+ *
#OPUS_AUTO
Not forced (default)
+ *
1
Forced mono
+ *
2
Forced stereo
+ *
+ * @hideinitializer */ +#define OPUS_GET_FORCE_CHANNELS(x) OPUS_GET_FORCE_CHANNELS_REQUEST, __opus_check_int_ptr(x) + +/** Configures the maximum bandpass that the encoder will select automatically. + * Applications should normally use this instead of #OPUS_SET_BANDWIDTH + * (leaving that set to the default, #OPUS_AUTO). This allows the + * application to set an upper bound based on the type of input it is + * providing, but still gives the encoder the freedom to reduce the bandpass + * when the bitrate becomes too low, for better overall quality. + * @see OPUS_GET_MAX_BANDWIDTH + * @param[in] x opus_int32: Allowed values: + *
+ *
OPUS_BANDWIDTH_NARROWBAND
4 kHz passband
+ *
OPUS_BANDWIDTH_MEDIUMBAND
6 kHz passband
+ *
OPUS_BANDWIDTH_WIDEBAND
8 kHz passband
+ *
OPUS_BANDWIDTH_SUPERWIDEBAND
12 kHz passband
+ *
OPUS_BANDWIDTH_FULLBAND
20 kHz passband (default)
+ *
+ * @hideinitializer */ +#define OPUS_SET_MAX_BANDWIDTH(x) OPUS_SET_MAX_BANDWIDTH_REQUEST, __opus_check_int(x) + +/** Gets the encoder's configured maximum allowed bandpass. + * @see OPUS_SET_MAX_BANDWIDTH + * @param[out] x opus_int32 *: Allowed values: + *
+ *
#OPUS_BANDWIDTH_NARROWBAND
4 kHz passband
+ *
#OPUS_BANDWIDTH_MEDIUMBAND
6 kHz passband
+ *
#OPUS_BANDWIDTH_WIDEBAND
8 kHz passband
+ *
#OPUS_BANDWIDTH_SUPERWIDEBAND
12 kHz passband
+ *
#OPUS_BANDWIDTH_FULLBAND
20 kHz passband (default)
+ *
+ * @hideinitializer */ +#define OPUS_GET_MAX_BANDWIDTH(x) OPUS_GET_MAX_BANDWIDTH_REQUEST, __opus_check_int_ptr(x) + +/** Sets the encoder's bandpass to a specific value. + * This prevents the encoder from automatically selecting the bandpass based + * on the available bitrate. If an application knows the bandpass of the input + * audio it is providing, it should normally use #OPUS_SET_MAX_BANDWIDTH + * instead, which still gives the encoder the freedom to reduce the bandpass + * when the bitrate becomes too low, for better overall quality. + * @see OPUS_GET_BANDWIDTH + * @param[in] x opus_int32: Allowed values: + *
+ *
#OPUS_AUTO
(default)
+ *
#OPUS_BANDWIDTH_NARROWBAND
4 kHz passband
+ *
#OPUS_BANDWIDTH_MEDIUMBAND
6 kHz passband
+ *
#OPUS_BANDWIDTH_WIDEBAND
8 kHz passband
+ *
#OPUS_BANDWIDTH_SUPERWIDEBAND
12 kHz passband
+ *
#OPUS_BANDWIDTH_FULLBAND
20 kHz passband
+ *
+ * @hideinitializer */ +#define OPUS_SET_BANDWIDTH(x) OPUS_SET_BANDWIDTH_REQUEST, __opus_check_int(x) + +/** Configures the type of signal being encoded. + * This is a hint which helps the encoder's mode selection. + * @see OPUS_GET_SIGNAL + * @param[in] x opus_int32: Allowed values: + *
+ *
#OPUS_AUTO
(default)
+ *
#OPUS_SIGNAL_VOICE
Bias thresholds towards choosing LPC or Hybrid modes.
+ *
#OPUS_SIGNAL_MUSIC
Bias thresholds towards choosing MDCT modes.
+ *
+ * @hideinitializer */ +#define OPUS_SET_SIGNAL(x) OPUS_SET_SIGNAL_REQUEST, __opus_check_int(x) +/** Gets the encoder's configured signal type. + * @see OPUS_SET_SIGNAL + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
#OPUS_AUTO
(default)
+ *
#OPUS_SIGNAL_VOICE
Bias thresholds towards choosing LPC or Hybrid modes.
+ *
#OPUS_SIGNAL_MUSIC
Bias thresholds towards choosing MDCT modes.
+ *
+ * @hideinitializer */ +#define OPUS_GET_SIGNAL(x) OPUS_GET_SIGNAL_REQUEST, __opus_check_int_ptr(x) + + +/** Configures the encoder's intended application. + * The initial value is a mandatory argument to the encoder_create function. + * @see OPUS_GET_APPLICATION + * @param[in] x opus_int32: Returns one of the following values: + *
+ *
#OPUS_APPLICATION_VOIP
+ *
Process signal for improved speech intelligibility.
+ *
#OPUS_APPLICATION_AUDIO
+ *
Favor faithfulness to the original input.
+ *
#OPUS_APPLICATION_RESTRICTED_LOWDELAY
+ *
Configure the minimum possible coding delay by disabling certain modes + * of operation.
+ *
+ * @hideinitializer */ +#define OPUS_SET_APPLICATION(x) OPUS_SET_APPLICATION_REQUEST, __opus_check_int(x) +/** Gets the encoder's configured application. + * @see OPUS_SET_APPLICATION + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
#OPUS_APPLICATION_VOIP
+ *
Process signal for improved speech intelligibility.
+ *
#OPUS_APPLICATION_AUDIO
+ *
Favor faithfulness to the original input.
+ *
#OPUS_APPLICATION_RESTRICTED_LOWDELAY
+ *
Configure the minimum possible coding delay by disabling certain modes + * of operation.
+ *
+ * @hideinitializer */ +#define OPUS_GET_APPLICATION(x) OPUS_GET_APPLICATION_REQUEST, __opus_check_int_ptr(x) + +/** Gets the sampling rate the encoder or decoder was initialized with. + * This simply returns the Fs value passed to opus_encoder_init() + * or opus_decoder_init(). + * @param[out] x opus_int32 *: Sampling rate of encoder or decoder. + * @hideinitializer + */ +#define OPUS_GET_SAMPLE_RATE(x) OPUS_GET_SAMPLE_RATE_REQUEST, __opus_check_int_ptr(x) + +/** Gets the total samples of delay added by the entire codec. + * This can be queried by the encoder and then the provided number of samples can be + * skipped on from the start of the decoder's output to provide time aligned input + * and output. From the perspective of a decoding application the real data begins this many + * samples late. + * + * The decoder contribution to this delay is identical for all decoders, but the + * encoder portion of the delay may vary from implementation to implementation, + * version to version, or even depend on the encoder's initial configuration. + * Applications needing delay compensation should call this CTL rather than + * hard-coding a value. + * @param[out] x opus_int32 *: Number of lookahead samples + * @hideinitializer */ +#define OPUS_GET_LOOKAHEAD(x) OPUS_GET_LOOKAHEAD_REQUEST, __opus_check_int_ptr(x) + +/** Configures the encoder's use of inband forward error correction (FEC). + * @note This is only applicable to the LPC layer + * @see OPUS_GET_INBAND_FEC + * @param[in] x opus_int32: Allowed values: + *
+ *
0
Disable inband FEC (default).
+ *
1
Enable inband FEC.
+ *
+ * @hideinitializer */ +#define OPUS_SET_INBAND_FEC(x) OPUS_SET_INBAND_FEC_REQUEST, __opus_check_int(x) +/** Gets encoder's configured use of inband forward error correction. + * @see OPUS_SET_INBAND_FEC + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
0
Inband FEC disabled (default).
+ *
1
Inband FEC enabled.
+ *
+ * @hideinitializer */ +#define OPUS_GET_INBAND_FEC(x) OPUS_GET_INBAND_FEC_REQUEST, __opus_check_int_ptr(x) + +/** Configures the encoder's expected packet loss percentage. + * Higher values with trigger progressively more loss resistant behavior in the encoder + * at the expense of quality at a given bitrate in the lossless case, but greater quality + * under loss. + * @see OPUS_GET_PACKET_LOSS_PERC + * @param[in] x opus_int32: Loss percentage in the range 0-100, inclusive (default: 0). + * @hideinitializer */ +#define OPUS_SET_PACKET_LOSS_PERC(x) OPUS_SET_PACKET_LOSS_PERC_REQUEST, __opus_check_int(x) +/** Gets the encoder's configured packet loss percentage. + * @see OPUS_SET_PACKET_LOSS_PERC + * @param[out] x opus_int32 *: Returns the configured loss percentage + * in the range 0-100, inclusive (default: 0). + * @hideinitializer */ +#define OPUS_GET_PACKET_LOSS_PERC(x) OPUS_GET_PACKET_LOSS_PERC_REQUEST, __opus_check_int_ptr(x) + +/** Configures the encoder's use of discontinuous transmission (DTX). + * @note This is only applicable to the LPC layer + * @see OPUS_GET_DTX + * @param[in] x opus_int32: Allowed values: + *
+ *
0
Disable DTX (default).
+ *
1
Enabled DTX.
+ *
+ * @hideinitializer */ +#define OPUS_SET_DTX(x) OPUS_SET_DTX_REQUEST, __opus_check_int(x) +/** Gets encoder's configured use of discontinuous transmission. + * @see OPUS_SET_DTX + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
0
DTX disabled (default).
+ *
1
DTX enabled.
+ *
+ * @hideinitializer */ +#define OPUS_GET_DTX(x) OPUS_GET_DTX_REQUEST, __opus_check_int_ptr(x) +/** Configures the depth of signal being encoded. + * This is a hint which helps the encoder identify silence and near-silence. + * @see OPUS_GET_LSB_DEPTH + * @param[in] x opus_int32: Input precision in bits, between 8 and 24 + * (default: 24). + * @hideinitializer */ +#define OPUS_SET_LSB_DEPTH(x) OPUS_SET_LSB_DEPTH_REQUEST, __opus_check_int(x) +/** Gets the encoder's configured signal depth. + * @see OPUS_SET_LSB_DEPTH + * @param[out] x opus_int32 *: Input precision in bits, between 8 and + * 24 (default: 24). + * @hideinitializer */ +#define OPUS_GET_LSB_DEPTH(x) OPUS_GET_LSB_DEPTH_REQUEST, __opus_check_int_ptr(x) + +/** Gets the duration (in samples) of the last packet successfully decoded or concealed. + * @param[out] x opus_int32 *: Number of samples (at current sampling rate). + * @hideinitializer */ +#define OPUS_GET_LAST_PACKET_DURATION(x) OPUS_GET_LAST_PACKET_DURATION_REQUEST, __opus_check_int_ptr(x) +/**@}*/ + +/** @defgroup opus_genericctls Generic CTLs + * + * These macros are used with the \c opus_decoder_ctl and + * \c opus_encoder_ctl calls to generate a particular + * request. + * + * When called on an \c OpusDecoder they apply to that + * particular decoder instance. When called on an + * \c OpusEncoder they apply to the corresponding setting + * on that encoder instance, if present. + * + * Some usage examples: + * + * @code + * int ret; + * opus_int32 pitch; + * ret = opus_decoder_ctl(dec_ctx, OPUS_GET_PITCH(&pitch)); + * if (ret == OPUS_OK) return ret; + * + * opus_encoder_ctl(enc_ctx, OPUS_RESET_STATE); + * opus_decoder_ctl(dec_ctx, OPUS_RESET_STATE); + * + * opus_int32 enc_bw, dec_bw; + * opus_encoder_ctl(enc_ctx, OPUS_GET_BANDWIDTH(&enc_bw)); + * opus_decoder_ctl(dec_ctx, OPUS_GET_BANDWIDTH(&dec_bw)); + * if (enc_bw != dec_bw) { + * printf("packet bandwidth mismatch!\n"); + * } + * @endcode + * + * @see opus_encoder, opus_decoder_ctl, opus_encoder_ctl, opus_decoderctls, opus_encoderctls + * @{ + */ + +/** Resets the codec state to be equivalent to a freshly initialized state. + * This should be called when switching streams in order to prevent + * the back to back decoding from giving different results from + * one at a time decoding. + * @hideinitializer */ +#define OPUS_RESET_STATE 4028 + +/** Gets the final state of the codec's entropy coder. + * This is used for testing purposes, + * The encoder and decoder state should be identical after coding a payload + * (assuming no data corruption or software bugs) + * + * @param[out] x opus_uint32 *: Entropy coder state + * + * @hideinitializer */ +#define OPUS_GET_FINAL_RANGE(x) OPUS_GET_FINAL_RANGE_REQUEST, __opus_check_uint_ptr(x) + +/** Gets the pitch of the last decoded frame, if available. + * This can be used for any post-processing algorithm requiring the use of pitch, + * e.g. time stretching/shortening. If the last frame was not voiced, or if the + * pitch was not coded in the frame, then zero is returned. + * + * This CTL is only implemented for decoder instances. + * + * @param[out] x opus_int32 *: pitch period at 48 kHz (or 0 if not available) + * + * @hideinitializer */ +#define OPUS_GET_PITCH(x) OPUS_GET_PITCH_REQUEST, __opus_check_int_ptr(x) + +/** Gets the encoder's configured bandpass or the decoder's last bandpass. + * @see OPUS_SET_BANDWIDTH + * @param[out] x opus_int32 *: Returns one of the following values: + *
+ *
#OPUS_AUTO
(default)
+ *
#OPUS_BANDWIDTH_NARROWBAND
4 kHz passband
+ *
#OPUS_BANDWIDTH_MEDIUMBAND
6 kHz passband
+ *
#OPUS_BANDWIDTH_WIDEBAND
8 kHz passband
+ *
#OPUS_BANDWIDTH_SUPERWIDEBAND
12 kHz passband
+ *
#OPUS_BANDWIDTH_FULLBAND
20 kHz passband
+ *
+ * @hideinitializer */ +#define OPUS_GET_BANDWIDTH(x) OPUS_GET_BANDWIDTH_REQUEST, __opus_check_int_ptr(x) + +/**@}*/ + +/** @defgroup opus_decoderctls Decoder related CTLs + * @see opus_genericctls, opus_encoderctls, opus_decoder + * @{ + */ + +/** Configures decoder gain adjustment. + * Scales the decoded output by a factor specified in Q8 dB units. + * This has a maximum range of -32768 to 32767 inclusive, and returns + * OPUS_BAD_ARG otherwise. The default is zero indicating no adjustment. + * This setting survives decoder reset. + * + * gain = pow(10, x/(20.0*256)) + * + * @param[in] x opus_int32: Amount to scale PCM signal by in Q8 dB units. + * @hideinitializer */ +#define OPUS_SET_GAIN(x) OPUS_SET_GAIN_REQUEST, __opus_check_int(x) +/** Gets the decoder's configured gain adjustment. @see OPUS_SET_GAIN + * + * @param[out] x opus_int32 *: Amount to scale PCM signal by in Q8 dB units. + * @hideinitializer */ +#define OPUS_GET_GAIN(x) OPUS_GET_GAIN_REQUEST, __opus_check_int_ptr(x) + +/**@}*/ + +/** @defgroup opus_libinfo Opus library information functions + * @{ + */ + +/** Converts an opus error code into a human readable string. + * + * @param[in] error int: Error number + * @returns Error string + */ +OPUS_EXPORT const char *opus_strerror(int error); + +/** Gets the libopus version string. + * + * @returns Version string + */ +OPUS_EXPORT const char *opus_get_version_string(void); +/**@}*/ + +#ifdef __cplusplus +} +#endif + +#endif /* OPUS_DEFINES_H */ diff --git a/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_multistream.h b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_multistream.h new file mode 100644 index 0000000..ae59979 --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_multistream.h @@ -0,0 +1,660 @@ +/* Copyright (c) 2011 Xiph.Org Foundation + Written by Jean-Marc Valin */ +/* + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + - Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + - Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER + OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF + LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +/** + * @file opus_multistream.h + * @brief Opus reference implementation multistream API + */ + +#ifndef OPUS_MULTISTREAM_H +#define OPUS_MULTISTREAM_H + +#include "opus.h" + +#ifdef __cplusplus +extern "C" { +#endif + +/** @cond OPUS_INTERNAL_DOC */ + +/** Macros to trigger compilation errors when the wrong types are provided to a + * CTL. */ +/**@{*/ +#define __opus_check_encstate_ptr(ptr) ((ptr) + ((ptr) - (OpusEncoder**)(ptr))) +#define __opus_check_decstate_ptr(ptr) ((ptr) + ((ptr) - (OpusDecoder**)(ptr))) +/**@}*/ + +/** These are the actual encoder and decoder CTL ID numbers. + * They should not be used directly by applications. + * In general, SETs should be even and GETs should be odd.*/ +/**@{*/ +#define OPUS_MULTISTREAM_GET_ENCODER_STATE_REQUEST 5120 +#define OPUS_MULTISTREAM_GET_DECODER_STATE_REQUEST 5122 +/**@}*/ + +/** @endcond */ + +/** @defgroup opus_multistream_ctls Multistream specific encoder and decoder CTLs + * + * These are convenience macros that are specific to the + * opus_multistream_encoder_ctl() and opus_multistream_decoder_ctl() + * interface. + * The CTLs from @ref opus_genericctls, @ref opus_encoderctls, and + * @ref opus_decoderctls may be applied to a multistream encoder or decoder as + * well. + * In addition, you may retrieve the encoder or decoder state for an specific + * stream via #OPUS_MULTISTREAM_GET_ENCODER_STATE or + * #OPUS_MULTISTREAM_GET_DECODER_STATE and apply CTLs to it individually. + */ +/**@{*/ + +/** Gets the encoder state for an individual stream of a multistream encoder. + * @param[in] x opus_int32: The index of the stream whose encoder you + * wish to retrieve. + * This must be non-negative and less than + * the streams parameter used + * to initialize the encoder. + * @param[out] y OpusEncoder**: Returns a pointer to the given + * encoder state. + * @retval OPUS_BAD_ARG The index of the requested stream was out of range. + * @hideinitializer + */ +#define OPUS_MULTISTREAM_GET_ENCODER_STATE(x,y) OPUS_MULTISTREAM_GET_ENCODER_STATE_REQUEST, __opus_check_int(x), __opus_check_encstate_ptr(y) + +/** Gets the decoder state for an individual stream of a multistream decoder. + * @param[in] x opus_int32: The index of the stream whose decoder you + * wish to retrieve. + * This must be non-negative and less than + * the streams parameter used + * to initialize the decoder. + * @param[out] y OpusDecoder**: Returns a pointer to the given + * decoder state. + * @retval OPUS_BAD_ARG The index of the requested stream was out of range. + * @hideinitializer + */ +#define OPUS_MULTISTREAM_GET_DECODER_STATE(x,y) OPUS_MULTISTREAM_GET_DECODER_STATE_REQUEST, __opus_check_int(x), __opus_check_decstate_ptr(y) + +/**@}*/ + +/** @defgroup opus_multistream Opus Multistream API + * @{ + * + * The multistream API allows individual Opus streams to be combined into a + * single packet, enabling support for up to 255 channels. Unlike an + * elementary Opus stream, the encoder and decoder must negotiate the channel + * configuration before the decoder can successfully interpret the data in the + * packets produced by the encoder. Some basic information, such as packet + * duration, can be computed without any special negotiation. + * + * The format for multistream Opus packets is defined in the + * Ogg + * encapsulation specification and is based on the self-delimited Opus + * framing described in Appendix B of RFC 6716. + * Normal Opus packets are just a degenerate case of multistream Opus packets, + * and can be encoded or decoded with the multistream API by setting + * streams to 1 when initializing the encoder or + * decoder. + * + * Multistream Opus streams can contain up to 255 elementary Opus streams. + * These may be either "uncoupled" or "coupled", indicating that the decoder + * is configured to decode them to either 1 or 2 channels, respectively. + * The streams are ordered so that all coupled streams appear at the + * beginning. + * + * A mapping table defines which decoded channel i + * should be used for each input/output (I/O) channel j. This table is + * typically provided as an unsigned char array. + * Let i = mapping[j] be the index for I/O channel j. + * If i < 2*coupled_streams, then I/O channel j is + * encoded as the left channel of stream (i/2) if i + * is even, or as the right channel of stream (i/2) if + * i is odd. Otherwise, I/O channel j is encoded as + * mono in stream (i - coupled_streams), unless it has the special + * value 255, in which case it is omitted from the encoding entirely (the + * decoder will reproduce it as silence). Each value i must either + * be the special value 255 or be less than streams + coupled_streams. + * + * The output channels specified by the encoder + * should use the + * Vorbis + * channel ordering. A decoder may wish to apply an additional permutation + * to the mapping the encoder used to achieve a different output channel + * order (e.g. for outputing in WAV order). + * + * Each multistream packet contains an Opus packet for each stream, and all of + * the Opus packets in a single multistream packet must have the same + * duration. Therefore the duration of a multistream packet can be extracted + * from the TOC sequence of the first stream, which is located at the + * beginning of the packet, just like an elementary Opus stream: + * + * @code + * int nb_samples; + * int nb_frames; + * nb_frames = opus_packet_get_nb_frames(data, len); + * if (nb_frames < 1) + * return nb_frames; + * nb_samples = opus_packet_get_samples_per_frame(data, 48000) * nb_frames; + * @endcode + * + * The general encoding and decoding process proceeds exactly the same as in + * the normal @ref opus_encoder and @ref opus_decoder APIs. + * See their documentation for an overview of how to use the corresponding + * multistream functions. + */ + +/** Opus multistream encoder state. + * This contains the complete state of a multistream Opus encoder. + * It is position independent and can be freely copied. + * @see opus_multistream_encoder_create + * @see opus_multistream_encoder_init + */ +typedef struct OpusMSEncoder OpusMSEncoder; + +/** Opus multistream decoder state. + * This contains the complete state of a multistream Opus decoder. + * It is position independent and can be freely copied. + * @see opus_multistream_decoder_create + * @see opus_multistream_decoder_init + */ +typedef struct OpusMSDecoder OpusMSDecoder; + +/**\name Multistream encoder functions */ +/**@{*/ + +/** Gets the size of an OpusMSEncoder structure. + * @param streams int: The total number of streams to encode from the + * input. + * This must be no more than 255. + * @param coupled_streams int: Number of coupled (2 channel) streams + * to encode. + * This must be no larger than the total + * number of streams. + * Additionally, The total number of + * encoded channels (streams + + * coupled_streams) must be no + * more than 255. + * @returns The size in bytes on success, or a negative error code + * (see @ref opus_errorcodes) on error. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_multistream_encoder_get_size( + int streams, + int coupled_streams +); + +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_multistream_surround_encoder_get_size( + int channels, + int mapping_family +); + + +/** Allocates and initializes a multistream encoder state. + * Call opus_multistream_encoder_destroy() to release + * this object when finished. + * @param Fs opus_int32: Sampling rate of the input signal (in Hz). + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param channels int: Number of channels in the input signal. + * This must be at most 255. + * It may be greater than the number of + * coded channels (streams + + * coupled_streams). + * @param streams int: The total number of streams to encode from the + * input. + * This must be no more than the number of channels. + * @param coupled_streams int: Number of coupled (2 channel) streams + * to encode. + * This must be no larger than the total + * number of streams. + * Additionally, The total number of + * encoded channels (streams + + * coupled_streams) must be no + * more than the number of input channels. + * @param[in] mapping const unsigned char[channels]: Mapping from + * encoded channels to input channels, as described in + * @ref opus_multistream. As an extra constraint, the + * multistream encoder does not allow encoding coupled + * streams for which one channel is unused since this + * is never a good idea. + * @param application int: The target encoder application. + * This must be one of the following: + *
+ *
#OPUS_APPLICATION_VOIP
+ *
Process signal for improved speech intelligibility.
+ *
#OPUS_APPLICATION_AUDIO
+ *
Favor faithfulness to the original input.
+ *
#OPUS_APPLICATION_RESTRICTED_LOWDELAY
+ *
Configure the minimum possible coding delay by disabling certain modes + * of operation.
+ *
+ * @param[out] error int *: Returns #OPUS_OK on success, or an error + * code (see @ref opus_errorcodes) on + * failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT OpusMSEncoder *opus_multistream_encoder_create( + opus_int32 Fs, + int channels, + int streams, + int coupled_streams, + const unsigned char *mapping, + int application, + int *error +) OPUS_ARG_NONNULL(5); + +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT OpusMSEncoder *opus_multistream_surround_encoder_create( + opus_int32 Fs, + int channels, + int mapping_family, + int *streams, + int *coupled_streams, + unsigned char *mapping, + int application, + int *error +) OPUS_ARG_NONNULL(5); + +/** Initialize a previously allocated multistream encoder state. + * The memory pointed to by \a st must be at least the size returned by + * opus_multistream_encoder_get_size(). + * This is intended for applications which use their own allocator instead of + * malloc. + * To reset a previously initialized state, use the #OPUS_RESET_STATE CTL. + * @see opus_multistream_encoder_create + * @see opus_multistream_encoder_get_size + * @param st OpusMSEncoder*: Multistream encoder state to initialize. + * @param Fs opus_int32: Sampling rate of the input signal (in Hz). + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param channels int: Number of channels in the input signal. + * This must be at most 255. + * It may be greater than the number of + * coded channels (streams + + * coupled_streams). + * @param streams int: The total number of streams to encode from the + * input. + * This must be no more than the number of channels. + * @param coupled_streams int: Number of coupled (2 channel) streams + * to encode. + * This must be no larger than the total + * number of streams. + * Additionally, The total number of + * encoded channels (streams + + * coupled_streams) must be no + * more than the number of input channels. + * @param[in] mapping const unsigned char[channels]: Mapping from + * encoded channels to input channels, as described in + * @ref opus_multistream. As an extra constraint, the + * multistream encoder does not allow encoding coupled + * streams for which one channel is unused since this + * is never a good idea. + * @param application int: The target encoder application. + * This must be one of the following: + *
+ *
#OPUS_APPLICATION_VOIP
+ *
Process signal for improved speech intelligibility.
+ *
#OPUS_APPLICATION_AUDIO
+ *
Favor faithfulness to the original input.
+ *
#OPUS_APPLICATION_RESTRICTED_LOWDELAY
+ *
Configure the minimum possible coding delay by disabling certain modes + * of operation.
+ *
+ * @returns #OPUS_OK on success, or an error code (see @ref opus_errorcodes) + * on failure. + */ +OPUS_EXPORT int opus_multistream_encoder_init( + OpusMSEncoder *st, + opus_int32 Fs, + int channels, + int streams, + int coupled_streams, + const unsigned char *mapping, + int application +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(6); + +OPUS_EXPORT int opus_multistream_surround_encoder_init( + OpusMSEncoder *st, + opus_int32 Fs, + int channels, + int mapping_family, + int *streams, + int *coupled_streams, + unsigned char *mapping, + int application +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(6); + +/** Encodes a multistream Opus frame. + * @param st OpusMSEncoder*: Multistream encoder state. + * @param[in] pcm const opus_int16*: The input signal as interleaved + * samples. + * This must contain + * frame_size*channels + * samples. + * @param frame_size int: Number of samples per channel in the input + * signal. + * This must be an Opus frame size for the + * encoder's sampling rate. + * For example, at 48 kHz the permitted values + * are 120, 240, 480, 960, 1920, and 2880. + * Passing in a duration of less than 10 ms + * (480 samples at 48 kHz) will prevent the + * encoder from using the LPC or hybrid modes. + * @param[out] data unsigned char*: Output payload. + * This must contain storage for at + * least \a max_data_bytes. + * @param [in] max_data_bytes opus_int32: Size of the allocated + * memory for the output + * payload. This may be + * used to impose an upper limit on + * the instant bitrate, but should + * not be used as the only bitrate + * control. Use #OPUS_SET_BITRATE to + * control the bitrate. + * @returns The length of the encoded packet (in bytes) on success or a + * negative error code (see @ref opus_errorcodes) on failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_multistream_encode( + OpusMSEncoder *st, + const opus_int16 *pcm, + int frame_size, + unsigned char *data, + opus_int32 max_data_bytes +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2) OPUS_ARG_NONNULL(4); + +/** Encodes a multistream Opus frame from floating point input. + * @param st OpusMSEncoder*: Multistream encoder state. + * @param[in] pcm const float*: The input signal as interleaved + * samples with a normal range of + * +/-1.0. + * Samples with a range beyond +/-1.0 + * are supported but will be clipped by + * decoders using the integer API and + * should only be used if it is known + * that the far end supports extended + * dynamic range. + * This must contain + * frame_size*channels + * samples. + * @param frame_size int: Number of samples per channel in the input + * signal. + * This must be an Opus frame size for the + * encoder's sampling rate. + * For example, at 48 kHz the permitted values + * are 120, 240, 480, 960, 1920, and 2880. + * Passing in a duration of less than 10 ms + * (480 samples at 48 kHz) will prevent the + * encoder from using the LPC or hybrid modes. + * @param[out] data unsigned char*: Output payload. + * This must contain storage for at + * least \a max_data_bytes. + * @param [in] max_data_bytes opus_int32: Size of the allocated + * memory for the output + * payload. This may be + * used to impose an upper limit on + * the instant bitrate, but should + * not be used as the only bitrate + * control. Use #OPUS_SET_BITRATE to + * control the bitrate. + * @returns The length of the encoded packet (in bytes) on success or a + * negative error code (see @ref opus_errorcodes) on failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_multistream_encode_float( + OpusMSEncoder *st, + const float *pcm, + int frame_size, + unsigned char *data, + opus_int32 max_data_bytes +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(2) OPUS_ARG_NONNULL(4); + +/** Frees an OpusMSEncoder allocated by + * opus_multistream_encoder_create(). + * @param st OpusMSEncoder*: Multistream encoder state to be freed. + */ +OPUS_EXPORT void opus_multistream_encoder_destroy(OpusMSEncoder *st); + +/** Perform a CTL function on a multistream Opus encoder. + * + * Generally the request and subsequent arguments are generated by a + * convenience macro. + * @param st OpusMSEncoder*: Multistream encoder state. + * @param request This and all remaining parameters should be replaced by one + * of the convenience macros in @ref opus_genericctls, + * @ref opus_encoderctls, or @ref opus_multistream_ctls. + * @see opus_genericctls + * @see opus_encoderctls + * @see opus_multistream_ctls + */ +OPUS_EXPORT int opus_multistream_encoder_ctl(OpusMSEncoder *st, int request, ...) OPUS_ARG_NONNULL(1); + +/**@}*/ + +/**\name Multistream decoder functions */ +/**@{*/ + +/** Gets the size of an OpusMSDecoder structure. + * @param streams int: The total number of streams coded in the + * input. + * This must be no more than 255. + * @param coupled_streams int: Number streams to decode as coupled + * (2 channel) streams. + * This must be no larger than the total + * number of streams. + * Additionally, The total number of + * coded channels (streams + + * coupled_streams) must be no + * more than 255. + * @returns The size in bytes on success, or a negative error code + * (see @ref opus_errorcodes) on error. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT opus_int32 opus_multistream_decoder_get_size( + int streams, + int coupled_streams +); + +/** Allocates and initializes a multistream decoder state. + * Call opus_multistream_decoder_destroy() to release + * this object when finished. + * @param Fs opus_int32: Sampling rate to decode at (in Hz). + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param channels int: Number of channels to output. + * This must be at most 255. + * It may be different from the number of coded + * channels (streams + + * coupled_streams). + * @param streams int: The total number of streams coded in the + * input. + * This must be no more than 255. + * @param coupled_streams int: Number of streams to decode as coupled + * (2 channel) streams. + * This must be no larger than the total + * number of streams. + * Additionally, The total number of + * coded channels (streams + + * coupled_streams) must be no + * more than 255. + * @param[in] mapping const unsigned char[channels]: Mapping from + * coded channels to output channels, as described in + * @ref opus_multistream. + * @param[out] error int *: Returns #OPUS_OK on success, or an error + * code (see @ref opus_errorcodes) on + * failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT OpusMSDecoder *opus_multistream_decoder_create( + opus_int32 Fs, + int channels, + int streams, + int coupled_streams, + const unsigned char *mapping, + int *error +) OPUS_ARG_NONNULL(5); + +/** Intialize a previously allocated decoder state object. + * The memory pointed to by \a st must be at least the size returned by + * opus_multistream_encoder_get_size(). + * This is intended for applications which use their own allocator instead of + * malloc. + * To reset a previously initialized state, use the #OPUS_RESET_STATE CTL. + * @see opus_multistream_decoder_create + * @see opus_multistream_deocder_get_size + * @param st OpusMSEncoder*: Multistream encoder state to initialize. + * @param Fs opus_int32: Sampling rate to decode at (in Hz). + * This must be one of 8000, 12000, 16000, + * 24000, or 48000. + * @param channels int: Number of channels to output. + * This must be at most 255. + * It may be different from the number of coded + * channels (streams + + * coupled_streams). + * @param streams int: The total number of streams coded in the + * input. + * This must be no more than 255. + * @param coupled_streams int: Number of streams to decode as coupled + * (2 channel) streams. + * This must be no larger than the total + * number of streams. + * Additionally, The total number of + * coded channels (streams + + * coupled_streams) must be no + * more than 255. + * @param[in] mapping const unsigned char[channels]: Mapping from + * coded channels to output channels, as described in + * @ref opus_multistream. + * @returns #OPUS_OK on success, or an error code (see @ref opus_errorcodes) + * on failure. + */ +OPUS_EXPORT int opus_multistream_decoder_init( + OpusMSDecoder *st, + opus_int32 Fs, + int channels, + int streams, + int coupled_streams, + const unsigned char *mapping +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(6); + +/** Decode a multistream Opus packet. + * @param st OpusMSDecoder*: Multistream decoder state. + * @param[in] data const unsigned char*: Input payload. + * Use a NULL + * pointer to indicate packet + * loss. + * @param len opus_int32: Number of bytes in payload. + * @param[out] pcm opus_int16*: Output signal, with interleaved + * samples. + * This must contain room for + * frame_size*channels + * samples. + * @param frame_size int: The number of samples per channel of + * available space in \a pcm. + * If this is less than the maximum packet duration + * (120 ms; 5760 for 48kHz), this function will not be capable + * of decoding some packets. In the case of PLC (data==NULL) + * or FEC (decode_fec=1), then frame_size needs to be exactly + * the duration of audio that is missing, otherwise the + * decoder will not be in the optimal state to decode the + * next incoming packet. For the PLC and FEC cases, frame_size + * must be a multiple of 2.5 ms. + * @param decode_fec int: Flag (0 or 1) to request that any in-band + * forward error correction data be decoded. + * If no such data is available, the frame is + * decoded as if it were lost. + * @returns Number of samples decoded on success or a negative error code + * (see @ref opus_errorcodes) on failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_multistream_decode( + OpusMSDecoder *st, + const unsigned char *data, + opus_int32 len, + opus_int16 *pcm, + int frame_size, + int decode_fec +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Decode a multistream Opus packet with floating point output. + * @param st OpusMSDecoder*: Multistream decoder state. + * @param[in] data const unsigned char*: Input payload. + * Use a NULL + * pointer to indicate packet + * loss. + * @param len opus_int32: Number of bytes in payload. + * @param[out] pcm opus_int16*: Output signal, with interleaved + * samples. + * This must contain room for + * frame_size*channels + * samples. + * @param frame_size int: The number of samples per channel of + * available space in \a pcm. + * If this is less than the maximum packet duration + * (120 ms; 5760 for 48kHz), this function will not be capable + * of decoding some packets. In the case of PLC (data==NULL) + * or FEC (decode_fec=1), then frame_size needs to be exactly + * the duration of audio that is missing, otherwise the + * decoder will not be in the optimal state to decode the + * next incoming packet. For the PLC and FEC cases, frame_size + * must be a multiple of 2.5 ms. + * @param decode_fec int: Flag (0 or 1) to request that any in-band + * forward error correction data be decoded. + * If no such data is available, the frame is + * decoded as if it were lost. + * @returns Number of samples decoded on success or a negative error code + * (see @ref opus_errorcodes) on failure. + */ +OPUS_EXPORT OPUS_WARN_UNUSED_RESULT int opus_multistream_decode_float( + OpusMSDecoder *st, + const unsigned char *data, + opus_int32 len, + float *pcm, + int frame_size, + int decode_fec +) OPUS_ARG_NONNULL(1) OPUS_ARG_NONNULL(4); + +/** Perform a CTL function on a multistream Opus decoder. + * + * Generally the request and subsequent arguments are generated by a + * convenience macro. + * @param st OpusMSDecoder*: Multistream decoder state. + * @param request This and all remaining parameters should be replaced by one + * of the convenience macros in @ref opus_genericctls, + * @ref opus_decoderctls, or @ref opus_multistream_ctls. + * @see opus_genericctls + * @see opus_decoderctls + * @see opus_multistream_ctls + */ +OPUS_EXPORT int opus_multistream_decoder_ctl(OpusMSDecoder *st, int request, ...) OPUS_ARG_NONNULL(1); + +/** Frees an OpusMSDecoder allocated by + * opus_multistream_decoder_create(). + * @param st OpusMSDecoder: Multistream decoder state to be freed. + */ +OPUS_EXPORT void opus_multistream_decoder_destroy(OpusMSDecoder *st); + +/**@}*/ + +/**@}*/ + +#ifdef __cplusplus +} +#endif + +#endif /* OPUS_MULTISTREAM_H */ diff --git a/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_types.h b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_types.h new file mode 100644 index 0000000..b28e03a --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/inc/opus_types.h @@ -0,0 +1,159 @@ +/* (C) COPYRIGHT 1994-2002 Xiph.Org Foundation */ +/* Modified by Jean-Marc Valin */ +/* + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + - Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + - Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER + OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF + LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ +/* opus_types.h based on ogg_types.h from libogg */ + +/** + @file opus_types.h + @brief Opus reference implementation types +*/ +#ifndef OPUS_TYPES_H +#define OPUS_TYPES_H + +/* Use the real stdint.h if it's there (taken from Paul Hsieh's pstdint.h) */ +#if (defined(__STDC__) && __STDC__ && __STDC_VERSION__ >= 199901L) || (defined(__GNUC__) && (defined(_STDINT_H) || defined(_STDINT_H_)) || defined (HAVE_STDINT_H)) +#include + + typedef int16_t opus_int16; + typedef uint16_t opus_uint16; + typedef int32_t opus_int32; + typedef uint32_t opus_uint32; +#elif defined(_WIN32) + +# if defined(__CYGWIN__) +# include <_G_config.h> + typedef _G_int32_t opus_int32; + typedef _G_uint32_t opus_uint32; + typedef _G_int16 opus_int16; + typedef _G_uint16 opus_uint16; +# elif defined(__MINGW32__) + typedef short opus_int16; + typedef unsigned short opus_uint16; + typedef int opus_int32; + typedef unsigned int opus_uint32; +# elif defined(__MWERKS__) + typedef int opus_int32; + typedef unsigned int opus_uint32; + typedef short opus_int16; + typedef unsigned short opus_uint16; +# else + /* MSVC/Borland */ + typedef __int32 opus_int32; + typedef unsigned __int32 opus_uint32; + typedef __int16 opus_int16; + typedef unsigned __int16 opus_uint16; +# endif + +#elif defined(__MACOS__) + +# include + typedef SInt16 opus_int16; + typedef UInt16 opus_uint16; + typedef SInt32 opus_int32; + typedef UInt32 opus_uint32; + +#elif (defined(__APPLE__) && defined(__MACH__)) /* MacOS X Framework build */ + +# include + typedef int16_t opus_int16; + typedef u_int16_t opus_uint16; + typedef int32_t opus_int32; + typedef u_int32_t opus_uint32; + +#elif defined(__BEOS__) + + /* Be */ +# include + typedef int16 opus_int16; + typedef u_int16 opus_uint16; + typedef int32_t opus_int32; + typedef u_int32_t opus_uint32; + +#elif defined (__EMX__) + + /* OS/2 GCC */ + typedef short opus_int16; + typedef unsigned short opus_uint16; + typedef int opus_int32; + typedef unsigned int opus_uint32; + +#elif defined (DJGPP) + + /* DJGPP */ + typedef short opus_int16; + typedef unsigned short opus_uint16; + typedef int opus_int32; + typedef unsigned int opus_uint32; + +#elif defined(R5900) + + /* PS2 EE */ + typedef int opus_int32; + typedef unsigned opus_uint32; + typedef short opus_int16; + typedef unsigned short opus_uint16; + +#elif defined(__SYMBIAN32__) + + /* Symbian GCC */ + typedef signed short opus_int16; + typedef unsigned short opus_uint16; + typedef signed int opus_int32; + typedef unsigned int opus_uint32; + +#elif defined(CONFIG_TI_C54X) || defined (CONFIG_TI_C55X) + + typedef short opus_int16; + typedef unsigned short opus_uint16; + typedef long opus_int32; + typedef unsigned long opus_uint32; + +#elif defined(CONFIG_TI_C6X) + + typedef short opus_int16; + typedef unsigned short opus_uint16; + typedef int opus_int32; + typedef unsigned int opus_uint32; + +#else + + /* Give up, take a reasonable guess */ + typedef short opus_int16; + typedef unsigned short opus_uint16; + typedef int opus_int32; + typedef unsigned int opus_uint32; + +#endif + +#define opus_int int /* used for counters etc; at least 16 bits */ +#define opus_int64 long long +#define opus_int8 signed char + +#define opus_uint unsigned int /* used for counters etc; at least 16 bits */ +#define opus_uint64 unsigned long long +#define opus_uint8 unsigned char + +#endif /* OPUS_TYPES_H */ diff --git a/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.c b/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.c new file mode 100644 index 0000000..c3514a8 --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.c @@ -0,0 +1,54 @@ +#include +#include +#include "nv_opus_dec.h" + +OpusDecoder* decoder; + +// This function must be called before +// any other decoding functions +int nv_opus_init(void) { + int err; + decoder = opus_decoder_create( + nv_opus_get_sample_rate(), + nv_opus_get_channel_count(), + &err); + return err; +} + +// This function must be called after +// decoding is finished +void nv_opus_destroy(void) { + if (decoder != NULL) { + opus_decoder_destroy(decoder); + } +} + +// The Opus stream is stereo +int nv_opus_get_channel_count(void) { + return 2; +} + +// This number assumes 2 channels at 48 KHz +int nv_opus_get_max_out_shorts(void) { + return 512*nv_opus_get_channel_count(); +} + +// The Opus stream is 48 KHz +int nv_opus_get_sample_rate(void) { + return 48000; +} + +// outpcmdata must be 5760*2 shorts in length +// packets must be decoded in order +// a packet loss must call this function with NULL indata and 0 inlen +// returns the number of decoded samples +int nv_opus_decode(unsigned char* indata, int inlen, short* outpcmdata) { + int err; + + // Decoding to 16-bit PCM with FEC off + // Maximum length assuming 48KHz sample rate + err = opus_decode(decoder, indata, inlen, + outpcmdata, 512, 0); + + return err; +} diff --git a/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.h b/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.h new file mode 100644 index 0000000..c5eb7f5 --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec.h @@ -0,0 +1,6 @@ +int nv_opus_init(void); +void nv_opus_destroy(void); +int nv_opus_get_channel_count(void); +int nv_opus_get_max_out_shorts(void); +int nv_opus_get_sample_rate(void); +int nv_opus_decode(unsigned char* indata, int inlen, short* outpcmdata); diff --git a/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec_jni.c b/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec_jni.c new file mode 100644 index 0000000..1df6988 --- /dev/null +++ b/limelight-pc/jni/nv_opus_dec/libopus/nv_opus_dec_jni.c @@ -0,0 +1,68 @@ +#include "nv_opus_dec.h" + +#include +#include + +// This function must be called before +// any other decoding functions +JNIEXPORT jint JNICALL +Java_com_limelight_nvstream_av_audio_OpusDecoder_init(JNIEnv *env, jobject this) { + return nv_opus_init(); +} + +// This function must be called after +// decoding is finished +JNIEXPORT void JNICALL +Java_com_limelight_nvstream_av_audio_OpusDecoder_destroy(JNIEnv *env, jobject this) { + nv_opus_destroy(); +} + +// The Opus stream is stereo +JNIEXPORT jint JNICALL +Java_com_limelight_nvstream_av_audio_OpusDecoder_getChannelCount(JNIEnv *env, jobject this) { + return nv_opus_get_channel_count(); +} + +// This number assumes 2 channels at 48 KHz +JNIEXPORT jint JNICALL +Java_com_limelight_nvstream_av_audio_OpusDecoder_getMaxOutputShorts(JNIEnv *env, jobject this) { + return nv_opus_get_max_out_shorts(); +} + +// The Opus stream is 48 KHz +JNIEXPORT jint JNICALL +Java_com_limelight_nvstream_av_audio_OpusDecoder_getSampleRate(JNIEnv *env, jobject this) { + return nv_opus_get_sample_rate(); +} + +// outpcmdata must be 5760*2 shorts in length +// packets must be decoded in order +// a packet loss must call this function with NULL indata and 0 inlen +// returns the number of decoded samples +JNIEXPORT jint JNICALL +Java_com_limelight_nvstream_av_audio_OpusDecoder_decode( + JNIEnv *env, jobject this, // JNI parameters + jbyteArray indata, jint inoff, jint inlen, // Input parameters + jshortArray outpcmdata) // Output parameter +{ + jint ret; + jbyte* jni_input_data; + jshort* jni_pcm_data; + + jni_pcm_data = (*env)->GetShortArrayElements(env, outpcmdata, 0); + if (indata != NULL) { + jni_input_data = (*env)->GetByteArrayElements(env, indata, 0); + + ret = nv_opus_decode(&jni_input_data[inoff], inlen, jni_pcm_data); + + // The input data isn't changed so it can be safely aborted + (*env)->ReleaseByteArrayElements(env, indata, jni_input_data, JNI_ABORT); + } + else { + ret = nv_opus_decode(NULL, 0, jni_pcm_data); + } + + (*env)->ReleaseShortArrayElements(env, outpcmdata, jni_pcm_data, 0); + + return ret; +} diff --git a/limelight-pc/src/com/limelight/#Limelight.java# b/limelight-pc/src/com/limelight/#Limelight.java# new file mode 100644 index 0000000..16aa6e8 --- /dev/null +++ b/limelight-pc/src/com/limelight/#Limelight.java# @@ -0,0 +1,30 @@ +package com.limelight; + +import com.limelight.gui.MainFrame; +import com.limelight.gui.StreamFrame; + +public class Limelight { + public static final double VERSION = 1.0; + + private final String HOST; + + + public Limelight(String host) { + this.HOST = host; + } + + private void startUp() { + StreamFrame streamFrame = new StreamFrame(); + streamFrame.build(); + } + + public static void createInstance(String host) { + Limelight limelight = new Limelight(host); + limelight.startUp(); + } + + public static void main(String args[]) { + MainFrame limeFrame = new MainFrame(); + limeFrame.build(); + } +} diff --git a/limelight-pc/src/com/limelight/Limelight.java b/limelight-pc/src/com/limelight/Limelight.java new file mode 100644 index 0000000..5db0bc1 --- /dev/null +++ b/limelight-pc/src/com/limelight/Limelight.java @@ -0,0 +1,66 @@ +package com.limelight; + +import javax.swing.JOptionPane; + +import com.limelight.gui.MainFrame; +import com.limelight.gui.StreamFrame; +import com.limelight.nvstream.NvConnection; +import com.limelight.nvstream.NvConnectionListener; + +public class Limelight implements NvConnectionListener { + public static final double VERSION = 1.0; + + private String host; + private StreamFrame streamFrame; + private NvConnection conn; + + public Limelight(String host) { + this.host = host; + } + + private void startUp() { + streamFrame = new StreamFrame(); + streamFrame.build(); + conn = new NvConnection(host, streamFrame, this); + conn.start(); + } + + public static void createInstance(String host) { + Limelight limelight = new Limelight(host); + limelight.startUp(); + } + + public static void main(String args[]) { + MainFrame limeFrame = new MainFrame(); + limeFrame.build(); + } + + @Override + public void stageStarting(Stage stage) { + System.out.println("Starting "+stage.getName()); + + } + + @Override + public void stageComplete(Stage stage) { + } + + @Override + public void stageFailed(Stage stage) { + JOptionPane.showMessageDialog(streamFrame, "Starting "+stage.getName()+" failed", "Connection Error", JOptionPane.ERROR_MESSAGE); + conn.stop(); + + } + + @Override + public void connectionStarted() { + } + + @Override + public void connectionTerminated(Exception e) { + e.printStackTrace(); + JOptionPane.showMessageDialog(streamFrame, "The connection failed unexpectedly", "Connection Terminated", JOptionPane.ERROR_MESSAGE); + conn.stop(); + } +} + diff --git a/limelight-pc/src/com/limelight/gui/MainFrame.java b/limelight-pc/src/com/limelight/gui/MainFrame.java new file mode 100644 index 0000000..38e0c06 --- /dev/null +++ b/limelight-pc/src/com/limelight/gui/MainFrame.java @@ -0,0 +1,90 @@ +package com.limelight.gui; + +import java.awt.BorderLayout; +import java.awt.Container; +import java.awt.Dimension; +import java.awt.event.ActionEvent; +import java.awt.event.ActionListener; + +import javax.swing.Box; +import javax.swing.BoxLayout; +import javax.swing.JButton; +import javax.swing.JFrame; +import javax.swing.JPanel; +import javax.swing.JTextField; + +import com.limelight.Limelight; + +public class MainFrame { + private JTextField hostField; + private JButton pair; + private JButton stream; + + public MainFrame() { + } + + public void build() { + JFrame limeFrame = new JFrame("Limelight V" + Limelight.VERSION); + limeFrame.setDefaultCloseOperation(JFrame.EXIT_ON_CLOSE); + Container mainPane = limeFrame.getContentPane(); + + mainPane.setLayout(new BorderLayout()); + + JPanel centerPane = new JPanel(); + centerPane.setLayout(new BoxLayout(centerPane, BoxLayout.Y_AXIS)); + + hostField = new JTextField(); + hostField.setMaximumSize(new Dimension(Integer.MAX_VALUE, 24)); + hostField.setToolTipText("Enter host name or IP address"); + hostField.setText("GeForce PC host"); + + stream = new JButton("Start Streaming"); + stream.addActionListener(createStreamButtonListener()); + stream.setToolTipText("Start the GeForce stream"); + + pair = new JButton("Pair"); + pair.addActionListener(createPairButtonListener()); + pair.setToolTipText("Send pair request to GeForce PC"); + + + Box streamBox = Box.createHorizontalBox(); + streamBox.add(Box.createHorizontalGlue()); + streamBox.add(stream); + streamBox.add(Box.createHorizontalGlue()); + + Box pairBox = Box.createHorizontalBox(); + pairBox.add(Box.createHorizontalGlue()); + pairBox.add(pair); + pairBox.add(Box.createHorizontalGlue()); + + Box contentBox = Box.createVerticalBox(); + contentBox.add(Box.createVerticalStrut(20)); + contentBox.add(hostField); + contentBox.add(Box.createVerticalStrut(10)); + contentBox.add(streamBox); + contentBox.add(Box.createVerticalStrut(10)); + contentBox.add(pairBox); + contentBox.add(Box.createVerticalGlue()); + + + centerPane.add(contentBox); + mainPane.add(centerPane, "Center"); + + limeFrame.setSize(1000, 800); + limeFrame.setVisible(true); + + } + + private ActionListener createStreamButtonListener() { + return new ActionListener() { + @Override + public void actionPerformed(ActionEvent e) { + Limelight.createInstance(hostField.getText()); + } + }; + } + + private ActionListener createPairButtonListener() { + return null; + } +} diff --git a/limelight-pc/src/com/limelight/gui/StreamFrame.java b/limelight-pc/src/com/limelight/gui/StreamFrame.java new file mode 100644 index 0000000..a03468b --- /dev/null +++ b/limelight-pc/src/com/limelight/gui/StreamFrame.java @@ -0,0 +1,11 @@ +package com.limelight.gui; + +import javax.swing.JFrame; + +public class StreamFrame extends JFrame { + private static final long serialVersionUID = 1L; + + public void build() { + + } +} diff --git a/limelight-pc/src/com/limelight/input/KeyboardHandler.java b/limelight-pc/src/com/limelight/input/KeyboardHandler.java new file mode 100644 index 0000000..e0f5da5 --- /dev/null +++ b/limelight-pc/src/com/limelight/input/KeyboardHandler.java @@ -0,0 +1,23 @@ +package com.limelight.input; + +import java.awt.event.KeyEvent; +import java.awt.event.KeyListener; + +public class KeyboardHandler implements KeyListener { + + @Override + public void keyPressed(KeyEvent event) { + + } + + @Override + public void keyReleased(KeyEvent event) { + // TODO Auto-generated method stub + + } + + @Override + public void keyTyped(KeyEvent event) { + } + +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvApp.java b/limelight-pc/src/com/limelight/nvstream/NvApp.java new file mode 100644 index 0000000..4ae0cc2 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvApp.java @@ -0,0 +1,31 @@ +package com.limelight.nvstream; + +public class NvApp { + private String appName; + private int appId; + private boolean isRunning; + + public void setAppName(String appName) { + this.appName = appName; + } + + public void setAppId(String appId) { + this.appId = Integer.parseInt(appId); + } + + public void setIsRunning(String isRunning) { + this.isRunning = isRunning.equals("1"); + } + + public String getAppName() { + return this.appName; + } + + public int getAppId() { + return this.appId; + } + + public boolean getIsRunning() { + return this.isRunning; + } +} \ No newline at end of file diff --git a/limelight-pc/src/com/limelight/nvstream/NvAudioStream.java b/limelight-pc/src/com/limelight/nvstream/NvAudioStream.java new file mode 100644 index 0000000..94d2fc4 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvAudioStream.java @@ -0,0 +1,250 @@ +package com.limelight.nvstream; + +import java.io.IOException; +import java.net.DatagramPacket; +import java.net.DatagramSocket; +import java.net.InetAddress; +import java.net.InetSocketAddress; +import java.net.SocketException; +import java.util.LinkedList; +import java.util.concurrent.LinkedBlockingQueue; + +import javax.sound.sampled.AudioFormat; +import javax.sound.sampled.SourceDataLine; + +import com.limelight.nvstream.av.AvByteBufferDescriptor; +import com.limelight.nvstream.av.AvRtpPacket; +import com.limelight.nvstream.av.AvShortBufferDescriptor; +import com.limelight.nvstream.av.audio.AvAudioDepacketizer; +import com.limelight.nvstream.av.audio.OpusDecoder; + +public class NvAudioStream { + public static final int RTP_PORT = 48000; + public static final int RTCP_PORT = 47999; + + private LinkedBlockingQueue packets = new LinkedBlockingQueue(100); + + private SourceDataLine track; + + private DatagramSocket rtp; + + private AvAudioDepacketizer depacketizer = new AvAudioDepacketizer(); + + private LinkedList threads = new LinkedList(); + + private boolean aborting = false; + + private InetAddress host; + private NvConnectionListener listener; + + public NvAudioStream(InetAddress host, NvConnectionListener listener) + { + this.host = host; + this.listener = listener; + } + + public void abort() + { + if (aborting) { + return; + } + + aborting = true; + + for (Thread t : threads) { + t.interrupt(); + } + + // Close the socket to interrupt the receive thread + if (rtp != null) { + rtp.close(); + } + + // Wait for threads to terminate + for (Thread t : threads) { + try { + t.join(); + } catch (InterruptedException e) { } + } + + if (track != null) { + track.close(); + } + + threads.clear(); + } + + public void startAudioStream() throws SocketException + { + setupRtpSession(); + + setupAudio(); + + startReceiveThread(); + + startDepacketizerThread(); + + startDecoderThread(); + + startUdpPingThread(); + } + + private void setupRtpSession() throws SocketException + { + rtp = new DatagramSocket(RTP_PORT); + } + + private void setupAudio() + { + int channelConfig; + int err; + + err = OpusDecoder.init(); + if (err != 0) { + throw new IllegalStateException("Opus decoder failed to initialize"); + } + + switch (OpusDecoder.getChannelCount()) + { + case 1: + channelConfig = 1; + break; + case 2: + channelConfig = 2; + break; + default: + throw new IllegalStateException("Opus decoder returned unhandled channel count"); + } + + /* + track = new AudioTrack(AudioManager.STREAM_MUSIC, + OpusDecoder.getSampleRate(), + channelConfig, + AudioFormat.ENCODING_PCM_16BIT, + 1024, // 1KB buffer + AudioTrack.MODE_STREAM); + + track.play();*/ + } + + private void startDepacketizerThread() + { + // This thread lessens the work on the receive thread + // so it can spend more time waiting for data + Thread t = new Thread() { + @Override + public void run() { + while (!isInterrupted()) + { + AvRtpPacket packet; + + try { + packet = packets.take(); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + + depacketizer.decodeInputData(packet); + } + } + }; + threads.add(t); + t.setName("Audio - Depacketizer"); + t.start(); + } + + private void startDecoderThread() + { + // Decoder thread + Thread t = new Thread() { + @Override + public void run() { + while (!isInterrupted()) + { + AvShortBufferDescriptor samples; + + try { + samples = depacketizer.getNextDecodedData(); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + + //track.write(samples.data, samples.offset, samples.length); + } + } + }; + threads.add(t); + t.setName("Audio - Player"); + t.start(); + } + + private void startReceiveThread() + { + // Receive thread + Thread t = new Thread() { + @Override + public void run() { + AvByteBufferDescriptor desc = new AvByteBufferDescriptor(new byte[1500], 0, 1500); + DatagramPacket packet = new DatagramPacket(desc.data, desc.length); + + while (!isInterrupted()) + { + try { + rtp.receive(packet); + } catch (IOException e) { + listener.connectionTerminated(e); + return; + } + + // Give the packet to the depacketizer thread + desc.length = packet.getLength(); + if (packets.offer(new AvRtpPacket(desc))) { + desc.reinitialize(new byte[1500], 0, 1500); + packet.setData(desc.data, desc.offset, desc.length); + } + } + } + }; + threads.add(t); + t.setName("Audio - Receive"); + t.start(); + } + + private void startUdpPingThread() + { + // Ping thread + Thread t = new Thread() { + @Override + public void run() { + // PING in ASCII + final byte[] pingPacketData = new byte[] {0x50, 0x49, 0x4E, 0x47}; + DatagramPacket pingPacket = new DatagramPacket(pingPacketData, pingPacketData.length); + pingPacket.setSocketAddress(new InetSocketAddress(host, RTP_PORT)); + + // Send PING every 100 ms + while (!isInterrupted()) + { + try { + rtp.send(pingPacket); + } catch (IOException e) { + listener.connectionTerminated(e); + return; + } + + try { + Thread.sleep(100); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + } + } + }; + threads.add(t); + t.setPriority(Thread.MIN_PRIORITY); + t.setName("Audio - Ping"); + t.start(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvConnection.java b/limelight-pc/src/com/limelight/nvstream/NvConnection.java new file mode 100644 index 0000000..8dcc220 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvConnection.java @@ -0,0 +1,245 @@ +package com.limelight.nvstream; + +import java.io.IOException; +import java.net.InetAddress; +import java.net.NetworkInterface; +import java.net.SocketException; +import java.net.UnknownHostException; +import java.util.Enumeration; +import java.util.concurrent.ThreadPoolExecutor; + +import javax.swing.JFrame; +import javax.swing.JOptionPane; +import javax.swing.SwingUtilities; +import javax.xml.stream.XMLStreamException; + +import com.limelight.nvstream.input.NvController; + +public class NvConnection { + private String host; + private JFrame parent; + private NvConnectionListener listener; + private int drFlags; + + private InetAddress hostAddr; + private NvControl controlStream; + private NvController inputStream; + private NvVideoStream videoStream; + private NvAudioStream audioStream; + + private ThreadPoolExecutor threadPool; + + public NvConnection(String host, JFrame parent, NvConnectionListener listener) { + this.host = host; + this.parent = parent; + this.listener = listener; + } + + public static String getMacAddressString() throws SocketException { + Enumeration ifaceList; + NetworkInterface selectedIface = null; + + // First look for a WLAN interface (since those generally aren't removable) + ifaceList = NetworkInterface.getNetworkInterfaces(); + while (selectedIface == null && ifaceList.hasMoreElements()) { + NetworkInterface iface = ifaceList.nextElement(); + + if (iface.getName().startsWith("wlan") && + iface.getHardwareAddress() != null) { + selectedIface = iface; + } + } + + // If we didn't find that, look for an Ethernet interface + ifaceList = NetworkInterface.getNetworkInterfaces(); + while (selectedIface == null && ifaceList.hasMoreElements()) { + NetworkInterface iface = ifaceList.nextElement(); + + if (iface.getName().startsWith("eth") && + iface.getHardwareAddress() != null) { + selectedIface = iface; + } + } + + // Now just find something with a MAC address + ifaceList = NetworkInterface.getNetworkInterfaces(); + while (selectedIface == null && ifaceList.hasMoreElements()) { + NetworkInterface iface = ifaceList.nextElement(); + + if (iface.getHardwareAddress() != null) { + selectedIface = ifaceList.nextElement(); + break; + } + } + + if (selectedIface == null) { + return null; + } + + byte[] macAddress = selectedIface.getHardwareAddress(); + if (macAddress != null) { + StringBuilder addrStr = new StringBuilder(); + for (int i = 0; i < macAddress.length; i++) { + addrStr.append(String.format("%02x", macAddress[i])); + if (i != macAddress.length - 1) { + addrStr.append(':'); + } + } + return addrStr.toString(); + } + + return null; + } + + public void start() { + new Thread(new Runnable() { + @Override + public void run() { + try { + hostAddr = InetAddress.getByName(host); + } catch (UnknownHostException e) { + e.printStackTrace(); + displayMessage(e.getMessage()); + listener.connectionTerminated(e); + return; + } + + establishConnection(); + + } + }).start(); + } + + + private void establishConnection() { + for (NvConnectionListener.Stage currentStage : NvConnectionListener.Stage.values()) + { + boolean success = false; + + listener.stageStarting(currentStage); + try { + switch (currentStage) + { + case LAUNCH_APP: + success = startSteamBigPicture(); + break; + + case HANDSHAKE: + success = NvHandshake.performHandshake(hostAddr); + break; + + case CONTROL_START: + success = startControlStream(); + break; + + case VIDEO_START: + success = startVideoStream(); + break; + + case AUDIO_START: + success = startAudioStream(); + break; + + case CONTROL_START2: + controlStream.startJitterPackets(); + success = true; + break; + + case INPUT_START: + success = startInputConnection(); + break; + } + } catch (Exception e) { + e.printStackTrace(); + success = false; + } + + if (success) { + listener.stageComplete(currentStage); + } + else { + listener.stageFailed(currentStage); + return; + } + } + + listener.connectionStarted(); + } + + private boolean startSteamBigPicture() throws XMLStreamException, IOException + { + System.out.println(hostAddr.toString() + "\t" + getMacAddressString()); + NvHTTP h = new NvHTTP(hostAddr.toString(), "");//getMacAddressString()); + + if (!h.getPairState()) { + displayMessage("Device not paired with computer"); + return false; + } + + int sessionId = h.getSessionId(); + int appId = h.getSteamAppId(sessionId); + + h.launchApp(sessionId, appId); + + return true; + } + + private boolean startControlStream() throws IOException + { + controlStream = new NvControl(hostAddr, listener); + controlStream.initialize(); + controlStream.start(); + return true; + } + + private boolean startVideoStream() throws IOException + { + videoStream = new NvVideoStream(hostAddr, listener, controlStream); + //videoStream.startVideoStream(video, drFlags); + return true; + } + + private boolean startAudioStream() throws IOException + { + audioStream = new NvAudioStream(hostAddr, listener); + audioStream.startAudioStream(); + return true; + } + + private boolean startInputConnection() throws IOException + { + inputStream = new NvController(hostAddr); + inputStream.initialize(); + return true; + } + + public void stop() + { + threadPool.shutdownNow(); + + if (videoStream != null) { + videoStream.abort(); + } + if (audioStream != null) { + audioStream.abort(); + } + + if (controlStream != null) { + controlStream.abort(); + } + + if (inputStream != null) { + inputStream.close(); + inputStream = null; + } + } + + private void displayMessage(final String text) { + SwingUtilities.invokeLater(new Runnable() { + @Override + public void run() { + JOptionPane.showMessageDialog(parent, text); + } + }); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvConnectionListener.java b/limelight-pc/src/com/limelight/nvstream/NvConnectionListener.java new file mode 100644 index 0000000..c929423 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvConnectionListener.java @@ -0,0 +1,30 @@ +package com.limelight.nvstream; + +public interface NvConnectionListener { + + public enum Stage { + LAUNCH_APP("app"), + HANDSHAKE("handshake"), + CONTROL_START("control connection"), + VIDEO_START("video stream"), + AUDIO_START("audio stream"), + CONTROL_START2("control connection"), + INPUT_START("input connection"); + + private String name; + private Stage(String name) { + this.name = name; + } + + public String getName() { + return name; + } + }; + + public void stageStarting(Stage stage); + public void stageComplete(Stage stage); + public void stageFailed(Stage stage); + + public void connectionStarted(); + public void connectionTerminated(Exception e); +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvControl.java b/limelight-pc/src/com/limelight/nvstream/NvControl.java new file mode 100644 index 0000000..4c08ea8 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvControl.java @@ -0,0 +1,483 @@ +package com.limelight.nvstream; + +import java.io.IOException; +import java.io.InputStream; +import java.io.OutputStream; +import java.net.InetAddress; +import java.net.InetSocketAddress; +import java.net.Socket; +import java.nio.ByteBuffer; +import java.nio.ByteOrder; + +import com.limelight.nvstream.av.ConnectionStatusListener; + +public class NvControl implements ConnectionStatusListener { + + public static final int PORT = 47995; + + public static final int CONTROL_TIMEOUT = 5000; + + public static final short PTYPE_HELLO = 0x1204; + public static final short PPAYLEN_HELLO = 0x0004; + public static final byte[] PPAYLOAD_HELLO = + { + (byte)0x00, + (byte)0x05, + (byte)0x00, + (byte)0x00 + }; + + public static final short PTYPE_KEEPALIVE = 0x13ff; + public static final short PPAYLEN_KEEPALIVE = 0x0000; + + public static final short PTYPE_HEARTBEAT = 0x1401; + public static final short PPAYLEN_HEARTBEAT = 0x0000; + + public static final short PTYPE_1405 = 0x1405; + public static final short PPAYLEN_1405 = 0x0000; + + public static final short PTYPE_RESYNC = 0x1404; + public static final short PPAYLEN_RESYNC = 16; + + public static final short PTYPE_CONFIG = 0x1205; + public static final short PPAYLEN_CONFIG = 0x0004; + public static final int[] PPAYLOAD_CONFIG = + { + 720, + 266758, + 1, + 266762, + 30, + 70151, + 68291329, + 1280, + 68291584, + 1280, + 68291840, + 15360, + 68292096, + 25600, + 68292352, + 2048, + 68292608, + 1024, + 68289024, + 262144, + 17957632, + 302055424, + 134217729, + 16777490, + 70153, + 68293120, + 768000, + 17961216, + 303235072, + 335609857, + 838861842, + 352321536, + 1006634002, + 369098752, + 335545362, + 385875968, + 1042, + 402653184, + 134218770, + 419430400, + 167773202, + 436207616, + 855638290, + 266779, + 7000, + 266780, + 2000, + 266781, + 50, + 266782, + 3000, + 266783, + 2, + 266794, + 5000, + 266795, + 500, + 266784, + 75, + 266785, + 25, + 266786, + 10, + 266787, + 60, + 266788, + 30, + 266789, + 3, + 266790, + 1000, + 266791, + 5000, + 266792, + 5000, + 266793, + 5000, + 70190, + 68301063, + 10240, + 68301312, + 6400, + 68301568, + 768000, + 68299776, + 768, + 68300032, + 2560, + 68300544, + 0, + 34746368, + (int)0xFE000000 + }; + + + public static final short PTYPE_JITTER = 0x140c; + public static final short PPAYLEN_JITTER = 0x10; + + private int seqNum; + + private NvConnectionListener listener; + private InetAddress host; + + private Socket s; + private InputStream in; + private OutputStream out; + + private Thread heartbeatThread; + private Thread jitterThread; + private boolean aborting = false; + + public NvControl(InetAddress host, NvConnectionListener listener) + { + this.listener = listener; + this.host = host; + } + + public void initialize() throws IOException + { + s = new Socket(); + s.setSoTimeout(CONTROL_TIMEOUT); + s.connect(new InetSocketAddress(host, PORT), CONTROL_TIMEOUT); + in = s.getInputStream(); + out = s.getOutputStream(); + } + + private void sendPacket(NvCtlPacket packet) throws IOException + { + out.write(packet.toWire()); + out.flush(); + } + + private NvControl.NvCtlResponse sendAndGetReply(NvCtlPacket packet) throws IOException + { + sendPacket(packet); + return new NvCtlResponse(in); + } + + private void sendJitter() throws IOException + { + ByteBuffer bb = ByteBuffer.allocate(16).order(ByteOrder.LITTLE_ENDIAN); + + bb.putInt(0); + bb.putInt(77); + bb.putInt(888); + bb.putInt(seqNum += 2); + + sendPacket(new NvCtlPacket(PTYPE_JITTER, PPAYLEN_JITTER, bb.array())); + } + + public void abort() + { + if (aborting) { + return; + } + + aborting = true; + + if (jitterThread != null) { + jitterThread.interrupt(); + } + + if (heartbeatThread != null) { + heartbeatThread.interrupt(); + } + + try { + s.close(); + } catch (IOException e) {} + } + + public void requestResync() throws IOException + { + System.out.println("CTL: Requesting IDR frame"); + sendResync(); + } + + public void start() throws IOException + { + sendHello(); + sendConfig(); + pingPong(); + send1405AndGetResponse(); + + heartbeatThread = new Thread() { + @Override + public void run() { + while (!isInterrupted()) + { + try { + sendHeartbeat(); + } catch (IOException e) { + listener.connectionTerminated(e); + return; + } + + + try { + Thread.sleep(3000); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + } + } + }; + heartbeatThread.start(); + } + + public void startJitterPackets() + { + jitterThread = new Thread() { + @Override + public void run() { + while (!isInterrupted()) + { + try { + sendJitter(); + } catch (IOException e) { + listener.connectionTerminated(e); + return; + } + + try { + Thread.sleep(100); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + } + } + }; + jitterThread.start(); + } + + private NvControl.NvCtlResponse send1405AndGetResponse() throws IOException + { + return sendAndGetReply(new NvCtlPacket(PTYPE_1405, PPAYLEN_1405)); + } + + private void sendHello() throws IOException + { + sendPacket(new NvCtlPacket(PTYPE_HELLO, PPAYLEN_HELLO, PPAYLOAD_HELLO)); + } + + private void sendResync() throws IOException + { + ByteBuffer conf = ByteBuffer.wrap(new byte[PPAYLEN_RESYNC]).order(ByteOrder.LITTLE_ENDIAN); + + conf.putLong(0); + conf.putLong(0xFFFF); + + sendAndGetReply(new NvCtlPacket(PTYPE_RESYNC, PPAYLEN_RESYNC, conf.array())); + } + + private void sendConfig() throws IOException + { + ByteBuffer conf = ByteBuffer.wrap(new byte[PPAYLOAD_CONFIG.length * 4 + 3]).order(ByteOrder.LITTLE_ENDIAN); + + for (int i : PPAYLOAD_CONFIG) + conf.putInt(i); + + conf.putShort((short)0x0013); + conf.put((byte) 0x00); + + sendPacket(new NvCtlPacket(PTYPE_CONFIG, PPAYLEN_CONFIG, conf.array())); + } + + private void sendHeartbeat() throws IOException + { + sendPacket(new NvCtlPacket(PTYPE_HEARTBEAT, PPAYLEN_HEARTBEAT)); + } + + private NvControl.NvCtlResponse pingPong() throws IOException + { + sendPacket(new NvCtlPacket(PTYPE_KEEPALIVE, PPAYLEN_KEEPALIVE)); + return new NvControl.NvCtlResponse(in); + } + + class NvCtlPacket { + public short type; + public short paylen; + public byte[] payload; + + public NvCtlPacket(InputStream in) throws IOException + { + byte[] header = new byte[4]; + + int offset = 0; + do + { + int bytesRead = in.read(header, offset, header.length - offset); + if (bytesRead < 0) { + break; + } + offset += bytesRead; + } while (offset != header.length); + + if (offset != header.length) { + throw new IOException("Socket closed prematurely"); + } + + ByteBuffer bb = ByteBuffer.wrap(header).order(ByteOrder.LITTLE_ENDIAN); + + type = bb.getShort(); + paylen = bb.getShort(); + + if (paylen != 0) + { + payload = new byte[paylen]; + + offset = 0; + do + { + int bytesRead = in.read(payload, offset, payload.length - offset); + if (bytesRead < 0) { + break; + } + offset += bytesRead; + } while (offset != payload.length); + + if (offset != payload.length) { + throw new IOException("Socket closed prematurely"); + } + } + } + + public NvCtlPacket(byte[] payload) + { + ByteBuffer bb = ByteBuffer.wrap(payload).order(ByteOrder.LITTLE_ENDIAN); + + type = bb.getShort(); + paylen = bb.getShort(); + + if (bb.hasRemaining()) + { + payload = new byte[bb.remaining()]; + bb.get(payload); + } + } + + public NvCtlPacket(short type, short paylen) + { + this.type = type; + this.paylen = paylen; + } + + public NvCtlPacket(short type, short paylen, byte[] payload) + { + this.type = type; + this.paylen = paylen; + this.payload = payload; + } + + public short getType() + { + return type; + } + + public short getPaylen() + { + return paylen; + } + + public void setType(short type) + { + this.type = type; + } + + public void setPaylen(short paylen) + { + this.paylen = paylen; + } + + public byte[] toWire() + { + ByteBuffer bb = ByteBuffer.allocate(4 + (payload != null ? payload.length : 0)).order(ByteOrder.LITTLE_ENDIAN); + + bb.putShort(type); + bb.putShort(paylen); + + if (payload != null) + bb.put(payload); + + return bb.array(); + } + } + + class NvCtlResponse extends NvCtlPacket { + public short status; + + public NvCtlResponse(InputStream in) throws IOException { + super(in); + } + + public NvCtlResponse(short type, short paylen) { + super(type, paylen); + } + + public NvCtlResponse(short type, short paylen, byte[] payload) { + super(type, paylen, payload); + } + + public NvCtlResponse(byte[] payload) { + super(payload); + } + + public void setStatusCode(short status) + { + this.status = status; + } + + public short getStatusCode() + { + return status; + } + } + + @Override + public void connectionTerminated() { + abort(); + } + + @Override + public void connectionNeedsResync() { + new Thread(new Runnable() { + @Override + public void run() { + try { + requestResync(); + } catch (IOException e1) { + abort(); + return; + } + } + }).start(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvHTTP.java b/limelight-pc/src/com/limelight/nvstream/NvHTTP.java new file mode 100644 index 0000000..a303999 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvHTTP.java @@ -0,0 +1,144 @@ +package com.limelight.nvstream; + +import java.io.IOException; +import java.io.InputStream; +import java.net.InetAddress; +import java.net.URL; +import java.net.UnknownHostException; +import java.util.LinkedList; +import java.util.Stack; + +import javax.xml.stream.XMLInputFactory; +import javax.xml.stream.XMLStreamException; +import javax.xml.stream.XMLStreamReader; + +public class NvHTTP { + private String macAddress; + + public static final int PORT = 47989; + public String baseUrl; + + public NvHTTP(String host, String macAddress) { + this.macAddress = macAddress; + this.baseUrl = "http://" + host + ":" + PORT; + } + + private String getXmlString(InputStream in, String tagname) + throws IOException, XMLStreamException { + XMLInputFactory factory = XMLInputFactory.newFactory(); + XMLStreamReader xReader = factory.createXMLStreamReader(in); + + int eventType = xReader.getEventType(); + Stack currentTag = new Stack(); + + while (eventType != XMLStreamReader.END_DOCUMENT) { + switch (eventType) { + case (XMLStreamReader.START_ELEMENT): + currentTag.push(xReader.getElementText()); + break; + case (XMLStreamReader.END_ELEMENT): + currentTag.pop(); + break; + case (XMLStreamReader.CHARACTERS): + if (currentTag.peek().equals(tagname)) { + return xReader.getElementText(); + } + break; + } + eventType = xReader.next(); + } + + return null; + } + + private InputStream openHttpConnection(String url) throws IOException { + return new URL(url).openConnection().getInputStream(); + } + + public String getAppVersion() throws XMLStreamException, IOException { + InputStream in = openHttpConnection(baseUrl + "/appversion"); + return getXmlString(in, "appversion"); + } + + public boolean getPairState() throws IOException, XMLStreamException { + InputStream in = openHttpConnection(baseUrl + "/pairstate?mac=" + macAddress); + String paired = getXmlString(in, "paired"); + return Integer.valueOf(paired) != 0; + } + + public int getSessionId() throws IOException, XMLStreamException { + /* Pass the model (minus spaces) as the device name */ + String deviceName = "Unknown"; + + try + { + InetAddress addr; + addr = InetAddress.getLocalHost(); + deviceName = addr.getHostName(); + } + catch (UnknownHostException ex) + { + System.out.println("Hostname can not be resolved"); + } + InputStream in = openHttpConnection(baseUrl + "/pair?mac=" + macAddress + + "&devicename=" + deviceName); + String sessionId = getXmlString(in, "sessionid"); + return Integer.parseInt(sessionId); + } + + public int getSteamAppId(int sessionId) throws IOException, + XMLStreamException { + LinkedList appList = getAppList(sessionId); + for (NvApp app : appList) { + if (app.getAppName().equals("Steam")) { + return app.getAppId(); + } + } + return 0; + } + + public LinkedList getAppList(int sessionId) throws IOException, XMLStreamException { + InputStream in = openHttpConnection(baseUrl + "/applist?session=" + sessionId); + XMLInputFactory factory = XMLInputFactory.newFactory(); + XMLStreamReader xReader = factory.createXMLStreamReader(in); + + int eventType = xReader.getEventType(); + LinkedList appList = new LinkedList(); + Stack currentTag = new Stack(); + + while (eventType != XMLStreamReader.END_DOCUMENT) { + switch (eventType) { + case (XMLStreamReader.START_ELEMENT): + currentTag.push(xReader.getName().toString()); + if (xReader.getName().toString().equals("App")) { + appList.addLast(new NvApp()); + } + break; + case (XMLStreamReader.END_DOCUMENT): + currentTag.pop(); + break; + case (XMLStreamReader.CHARACTERS): + NvApp app = appList.getLast(); + if (currentTag.peek().equals("AppTitle")) { + app.setAppName(xReader.getText()); + } else if (currentTag.peek().equals("ID")) { + app.setAppId(xReader.getText()); + } else if (currentTag.peek().equals("IsRunning")) { + app.setIsRunning(xReader.getText()); + } + break; + } + eventType = xReader.next(); + } + return appList; + } + + // Returns gameSession XML attribute + public int launchApp(int sessionId, int appId) throws IOException, + XMLStreamException { + InputStream in = openHttpConnection(baseUrl + "/launch?session=" + + sessionId + "&appid=" + appId); + String gameSession = getXmlString(in, "gamesession"); + return Integer.parseInt(gameSession); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvHandshake.java b/limelight-pc/src/com/limelight/nvstream/NvHandshake.java new file mode 100644 index 0000000..db111d1 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvHandshake.java @@ -0,0 +1,133 @@ +package com.limelight.nvstream; + +import java.io.IOException; +import java.io.InputStream; +import java.io.OutputStream; +import java.net.InetAddress; +import java.net.InetSocketAddress; +import java.net.Socket; + +public class NvHandshake { + public static final int PORT = 47991; + + public static final int HANDSHAKE_TIMEOUT = 5000; + + public static final byte[] PLATFORM_HELLO = + { + (byte)0x07, + (byte)0x00, + (byte)0x00, + (byte)0x00, + + // android in ASCII + (byte)0x61, + (byte)0x6e, + (byte)0x64, + (byte)0x72, + (byte)0x6f, + (byte)0x69, + (byte)0x64, + + (byte)0x03, + (byte)0x01, + (byte)0x00, + (byte)0x00 + }; + + public static final byte[] PACKET_2 = + { + (byte)0x01, + (byte)0x03, + (byte)0x02, + (byte)0x00, + (byte)0x08, + (byte)0x00 + }; + + public static final byte[] PACKET_3 = + { + (byte)0x04, + (byte)0x01, + (byte)0x00, + (byte)0x00, + + (byte)0x00, + (byte)0x00, + (byte)0x00, + (byte)0x00 + }; + + public static final byte[] PACKET_4 = + { + (byte)0x01, + (byte)0x01, + (byte)0x00, + (byte)0x00 + }; + + private static boolean waitAndDiscardResponse(InputStream in) + { + // Wait for response and discard response + try { + in.read(); + + // Wait for the full response to come in + Thread.sleep(250); + + for (int i = 0; i < in.available(); i++) + in.read(); + + } catch (IOException e1) { + return false; + } catch (InterruptedException e) { + return false; + } + + return true; + } + + public static boolean performHandshake(InetAddress host) throws IOException + { + Socket s = new Socket(); + s.connect(new InetSocketAddress(host, PORT), HANDSHAKE_TIMEOUT); + s.setSoTimeout(HANDSHAKE_TIMEOUT); + OutputStream out = s.getOutputStream(); + InputStream in = s.getInputStream(); + + // First packet + out.write(PLATFORM_HELLO); + out.flush(); + + if (!waitAndDiscardResponse(in)) { + s.close(); + return false; + } + + // Second packet + out.write(PACKET_2); + out.flush(); + + if (!waitAndDiscardResponse(in)) { + s.close(); + return false; + } + + // Third packet + out.write(PACKET_3); + out.flush(); + + if (!waitAndDiscardResponse(in)) { + s.close(); + return false; + } + + // Fourth packet + out.write(PACKET_4); + out.flush(); + + // Done + s.close(); + + return true; + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/NvVideoStream.java b/limelight-pc/src/com/limelight/nvstream/NvVideoStream.java new file mode 100644 index 0000000..a3f99a5 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/NvVideoStream.java @@ -0,0 +1,307 @@ +package com.limelight.nvstream; + +import java.io.IOException; +import java.io.InputStream; +import java.net.DatagramPacket; +import java.net.DatagramSocket; +import java.net.InetAddress; +import java.net.InetSocketAddress; +import java.net.Socket; +import java.net.SocketException; +import java.util.LinkedList; +import java.util.concurrent.LinkedBlockingQueue; + +import com.limelight.nvstream.av.AvByteBufferDescriptor; +import com.limelight.nvstream.av.AvDecodeUnit; +import com.limelight.nvstream.av.AvRtpPacket; +import com.limelight.nvstream.av.ConnectionStatusListener; +import com.limelight.nvstream.av.video.AvVideoDepacketizer; +import com.limelight.nvstream.av.video.AvVideoPacket; +import com.limelight.nvstream.av.video.CpuDecoderRenderer; +import com.limelight.nvstream.av.video.DecoderRenderer; + +public class NvVideoStream { + public static final int RTP_PORT = 47998; + public static final int RTCP_PORT = 47999; + public static final int FIRST_FRAME_PORT = 47996; + + public static final int FIRST_FRAME_TIMEOUT = 5000; + + private LinkedBlockingQueue packets = new LinkedBlockingQueue(100); + + private InetAddress host; + private DatagramSocket rtp; + private Socket firstFrameSocket; + + private LinkedList threads = new LinkedList(); + + private NvConnectionListener listener; + private AvVideoDepacketizer depacketizer; + + private DecoderRenderer decrend; + private boolean startedRendering; + + private boolean aborting = false; + + public NvVideoStream(InetAddress host, NvConnectionListener listener, ConnectionStatusListener avConnListener) + { + this.host = host; + this.listener = listener; + this.depacketizer = new AvVideoDepacketizer(avConnListener); + } + + public void abort() + { + if (aborting) { + return; + } + + aborting = true; + + // Interrupt threads + for (Thread t : threads) { + t.interrupt(); + } + + // Close the socket to interrupt the receive thread + if (rtp != null) { + rtp.close(); + } + if (firstFrameSocket != null) { + try { + firstFrameSocket.close(); + } catch (IOException e) {} + } + + // Wait for threads to terminate + for (Thread t : threads) { + try { + t.join(); + } catch (InterruptedException e) { } + } + + if (startedRendering) { + decrend.stop(); + } + + if (decrend != null) { + decrend.release(); + } + + threads.clear(); + } + + private void readFirstFrame() throws IOException + { + byte[] firstFrame = new byte[1500]; + + firstFrameSocket = new Socket(); + firstFrameSocket.setSoTimeout(FIRST_FRAME_TIMEOUT); + + try { + firstFrameSocket.connect(new InetSocketAddress(host, FIRST_FRAME_PORT), FIRST_FRAME_TIMEOUT); + InputStream firstFrameStream = firstFrameSocket.getInputStream(); + + int offset = 0; + for (;;) + { + int bytesRead = firstFrameStream.read(firstFrame, offset, firstFrame.length-offset); + + if (bytesRead == -1) + break; + + offset += bytesRead; + } + + depacketizer.addInputData(new AvVideoPacket(new AvByteBufferDescriptor(firstFrame, 0, offset))); + } finally { + firstFrameSocket.close(); + firstFrameSocket = null; + } + } + + public void setupRtpSession() throws SocketException + { + rtp = new DatagramSocket(RTP_PORT); + } + + /* + public void setupDecoderRenderer(SurfaceHolder renderTarget, int drFlags) { + if (Build.HARDWARE.equals("goldfish")) { + // Emulator - don't render video (it's slow!) + decrend = null; + } + else if (MediaCodecDecoderRenderer.findSafeDecoder() != null) { + // Hardware decoding + decrend = new MediaCodecDecoderRenderer(); + } + else { + // Software decoding + decrend = new CpuDecoderRenderer(); + } + + if (decrend != null) { + decrend.setup(1280, 720, renderTarget, drFlags); + } + }*/ + + /* + public void startVideoStream(final SurfaceHolder surface, int drFlags) throws IOException + { + // Setup the decoder and renderer + setupDecoderRenderer(surface, drFlags); + + // Open RTP sockets and start session + setupRtpSession(); + + // Start pinging before reading the first frame + // so Shield Proxy knows we're here and sends us + // the reference frame + startUdpPingThread(); + + // Read the first frame to start the UDP video stream + // This MUST be called before the normal UDP receive thread + // starts in order to avoid state corruption caused by two + // threads simultaneously adding input data. + readFirstFrame(); + + if (decrend != null) { + // Start the receive thread early to avoid missing + // early packets + startReceiveThread(); + + // Start the depacketizer thread to deal with the RTP data + startDepacketizerThread(); + + // Start decoding the data we're receiving + startDecoderThread(); + + // Start the renderer + decrend.start(); + startedRendering = true; + } + } + */ + private void startDecoderThread() + { + Thread t = new Thread() { + @Override + public void run() { + // Read the decode units generated from the RTP stream + while (!isInterrupted()) + { + AvDecodeUnit du; + + try { + du = depacketizer.getNextDecodeUnit(); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + + decrend.submitDecodeUnit(du); + } + } + }; + threads.add(t); + t.setName("Video - Decoder"); + t.setPriority(Thread.MAX_PRIORITY); + t.start(); + } + + private void startDepacketizerThread() + { + // This thread lessens the work on the receive thread + // so it can spend more time waiting for data + Thread t = new Thread() { + @Override + public void run() { + while (!isInterrupted()) + { + AvRtpPacket packet; + + try { + packet = packets.take(); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + + // !!! We no longer own the data buffer at this point !!! + depacketizer.addInputData(packet); + } + } + }; + threads.add(t); + t.setName("Video - Depacketizer"); + t.start(); + } + + private void startReceiveThread() + { + // Receive thread + Thread t = new Thread() { + @Override + public void run() { + AvByteBufferDescriptor desc = new AvByteBufferDescriptor(new byte[1500], 0, 1500); + DatagramPacket packet = new DatagramPacket(desc.data, desc.length); + + while (!isInterrupted()) + { + try { + rtp.receive(packet); + } catch (IOException e) { + listener.connectionTerminated(e); + return; + } + + // Give the packet to the depacketizer thread + desc.length = packet.getLength(); + if (packets.offer(new AvRtpPacket(desc))) { + desc.reinitialize(new byte[1500], 0, 1500); + packet.setData(desc.data, desc.offset, desc.length); + } + } + } + }; + threads.add(t); + t.setName("Video - Receive"); + t.start(); + } + + private void startUdpPingThread() + { + // Ping thread + Thread t = new Thread() { + @Override + public void run() { + // PING in ASCII + final byte[] pingPacketData = new byte[] {0x50, 0x49, 0x4E, 0x47}; + DatagramPacket pingPacket = new DatagramPacket(pingPacketData, pingPacketData.length); + pingPacket.setSocketAddress(new InetSocketAddress(host, RTP_PORT)); + + // Send PING every 100 ms + while (!isInterrupted()) + { + try { + rtp.send(pingPacket); + } catch (IOException e) { + listener.connectionTerminated(e); + return; + } + + try { + Thread.sleep(100); + } catch (InterruptedException e) { + listener.connectionTerminated(e); + return; + } + } + } + }; + threads.add(t); + t.setName("Video - Ping"); + t.setPriority(Thread.MIN_PRIORITY); + t.start(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/AvByteBufferDescriptor.java b/limelight-pc/src/com/limelight/nvstream/av/AvByteBufferDescriptor.java new file mode 100644 index 0000000..8f11a95 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/AvByteBufferDescriptor.java @@ -0,0 +1,46 @@ +package com.limelight.nvstream.av; + +public class AvByteBufferDescriptor { + public byte[] data; + public int offset; + public int length; + + public AvByteBufferDescriptor(byte[] data, int offset, int length) + { + this.data = data; + this.offset = offset; + this.length = length; + } + + public AvByteBufferDescriptor(AvByteBufferDescriptor desc) + { + this.data = desc.data; + this.offset = desc.offset; + this.length = desc.length; + } + + public void reinitialize(byte[] data, int offset, int length) + { + this.data = data; + this.offset = offset; + this.length = length; + } + + public void print() + { + print(offset, length); + } + + public void print(int length) + { + print(this.offset, length); + } + + public void print(int offset, int length) + { + for (int i = offset; i < offset+length; i++) { + System.out.printf("%d: %02x \n", i, data[i]); + } + System.out.println(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/AvDecodeUnit.java b/limelight-pc/src/com/limelight/nvstream/av/AvDecodeUnit.java new file mode 100644 index 0000000..69300b8 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/AvDecodeUnit.java @@ -0,0 +1,42 @@ +package com.limelight.nvstream.av; + +import java.util.List; + +public class AvDecodeUnit { + public static final int TYPE_UNKNOWN = 0; + public static final int TYPE_H264 = 1; + public static final int TYPE_OPUS = 2; + + private int type; + private List bufferList; + private int dataLength; + private int flags; + + public AvDecodeUnit(int type, List bufferList, int dataLength, int flags) + { + this.type = type; + this.bufferList = bufferList; + this.dataLength = dataLength; + this.flags = flags; + } + + public int getType() + { + return type; + } + + public int getFlags() + { + return flags; + } + + public List getBufferList() + { + return bufferList; + } + + public int getDataLength() + { + return dataLength; + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/AvRtpPacket.java b/limelight-pc/src/com/limelight/nvstream/av/AvRtpPacket.java new file mode 100644 index 0000000..8e4250e --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/AvRtpPacket.java @@ -0,0 +1,46 @@ +package com.limelight.nvstream.av; + +import java.nio.ByteBuffer; + +public class AvRtpPacket { + + private byte packetType; + private short seqNum; + private AvByteBufferDescriptor buffer; + + public AvRtpPacket(AvByteBufferDescriptor buffer) + { + this.buffer = new AvByteBufferDescriptor(buffer); + + ByteBuffer bb = ByteBuffer.wrap(buffer.data, buffer.offset, buffer.length); + + // Discard the first byte + bb.position(bb.position()+1); + + // Get the packet type + packetType = bb.get(); + + // Get the sequence number + seqNum = bb.getShort(); + } + + public byte getPacketType() + { + return packetType; + } + + public short getSequenceNumber() + { + return seqNum; + } + + public byte[] getBackingBuffer() + { + return buffer.data; + } + + public AvByteBufferDescriptor getNewPayloadDescriptor() + { + return new AvByteBufferDescriptor(buffer.data, buffer.offset+12, buffer.length-12); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/AvShortBufferDescriptor.java b/limelight-pc/src/com/limelight/nvstream/av/AvShortBufferDescriptor.java new file mode 100644 index 0000000..901783f --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/AvShortBufferDescriptor.java @@ -0,0 +1,28 @@ +package com.limelight.nvstream.av; + +public class AvShortBufferDescriptor { + public short[] data; + public int offset; + public int length; + + public AvShortBufferDescriptor(short[] data, int offset, int length) + { + this.data = data; + this.offset = offset; + this.length = length; + } + + public AvShortBufferDescriptor(AvShortBufferDescriptor desc) + { + this.data = desc.data; + this.offset = desc.offset; + this.length = desc.length; + } + + public void reinitialize(short[] data, int offset, int length) + { + this.data = data; + this.offset = offset; + this.length = length; + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/ConnectionStatusListener.java b/limelight-pc/src/com/limelight/nvstream/av/ConnectionStatusListener.java new file mode 100644 index 0000000..35262dd --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/ConnectionStatusListener.java @@ -0,0 +1,7 @@ +package com.limelight.nvstream.av; + +public interface ConnectionStatusListener { + public void connectionTerminated(); + + public void connectionNeedsResync(); +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/audio/AvAudioDepacketizer.java b/limelight-pc/src/com/limelight/nvstream/av/audio/AvAudioDepacketizer.java new file mode 100644 index 0000000..a13cf3e --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/audio/AvAudioDepacketizer.java @@ -0,0 +1,65 @@ +package com.limelight.nvstream.av.audio; + +import java.util.concurrent.LinkedBlockingQueue; + +import com.limelight.nvstream.av.AvByteBufferDescriptor; +import com.limelight.nvstream.av.AvRtpPacket; +import com.limelight.nvstream.av.AvShortBufferDescriptor; + +public class AvAudioDepacketizer { + + private static final int DU_LIMIT = 15; + private LinkedBlockingQueue decodedUnits = + new LinkedBlockingQueue(DU_LIMIT); + + // Sequencing state + private short lastSequenceNumber; + + private void decodeData(byte[] data, int off, int len) + { + // Submit this data to the decoder + short[] pcmData = new short[OpusDecoder.getMaxOutputShorts()]; + int decodeLen = OpusDecoder.decode(data, off, len, pcmData); + + if (decodeLen > 0) { + // Return value of decode is frames decoded per channel + decodeLen *= OpusDecoder.getChannelCount(); + + // Put it on the decoded queue + if (!decodedUnits.offer(new AvShortBufferDescriptor(pcmData, 0, decodeLen))) { + // Clear out the queue + decodedUnits.clear(); + } + } + } + + public void decodeInputData(AvRtpPacket packet) + { + short seq = packet.getSequenceNumber(); + + if (packet.getPacketType() != 97) { + // Only type 97 is audio + return; + } + + // Toss out the current NAL if we receive a packet that is + // out of sequence + if (lastSequenceNumber != 0 && + (short)(lastSequenceNumber + 1) != seq) + { + System.out.println("Received OOS audio data (expected "+(lastSequenceNumber + 1)+", got "+seq+")"); + decodeData(null, 0, 0); + } + + lastSequenceNumber = seq; + + // This is all the depacketizing we need to do + AvByteBufferDescriptor rtpPayload = packet.getNewPayloadDescriptor(); + decodeData(rtpPayload.data, rtpPayload.offset, rtpPayload.length); + } + + public AvShortBufferDescriptor getNextDecodedData() throws InterruptedException + { + return decodedUnits.take(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/audio/OpusDecoder.java b/limelight-pc/src/com/limelight/nvstream/av/audio/OpusDecoder.java new file mode 100644 index 0000000..c01f7fa --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/audio/OpusDecoder.java @@ -0,0 +1,14 @@ +package com.limelight.nvstream.av.audio; + +public class OpusDecoder { + static { + System.loadLibrary("nv_opus_dec"); + } + + public static native int init(); + public static native void destroy(); + public static native int getChannelCount(); + public static native int getMaxOutputShorts(); + public static native int getSampleRate(); + public static native int decode(byte[] indata, int inoff, int inlen, short[] outpcmdata); +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/video/AvVideoDepacketizer.java b/limelight-pc/src/com/limelight/nvstream/av/video/AvVideoDepacketizer.java new file mode 100644 index 0000000..17336c0 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/video/AvVideoDepacketizer.java @@ -0,0 +1,313 @@ +package com.limelight.nvstream.av.video; + +import java.util.LinkedList; +import java.util.concurrent.LinkedBlockingQueue; + +import com.limelight.nvstream.av.AvByteBufferDescriptor; +import com.limelight.nvstream.av.AvDecodeUnit; +import com.limelight.nvstream.av.AvRtpPacket; +import com.limelight.nvstream.av.ConnectionStatusListener; + +public class AvVideoDepacketizer { + + // Current NAL state + private LinkedList avcNalDataChain = null; + private int avcNalDataLength = 0; + private int currentlyDecoding; + + // Cached buffer descriptor to save on allocations + // Only safe to use in decode thread!!!! + private AvByteBufferDescriptor cachedDesc; + + // Sequencing state + private short lastSequenceNumber; + + private ConnectionStatusListener controlListener; + + private static final int DU_LIMIT = 15; + private LinkedBlockingQueue decodedUnits = new LinkedBlockingQueue(DU_LIMIT); + + public AvVideoDepacketizer(ConnectionStatusListener controlListener) + { + this.controlListener = controlListener; + this.cachedDesc = new AvByteBufferDescriptor(null, 0, 0); + } + + private void clearAvcNalState() + { + avcNalDataChain = null; + avcNalDataLength = 0; + } + + private void reassembleAvcNal() + { + // This is the start of a new NAL + if (avcNalDataChain != null && avcNalDataLength != 0) + { + int flags = 0; + + // Check if this is a special NAL unit + AvByteBufferDescriptor header = avcNalDataChain.getFirst(); + + if (NAL.getSpecialSequenceDescriptor(header, cachedDesc)) + { + // The next byte after the special sequence is the NAL header + byte nalHeader = cachedDesc.data[cachedDesc.offset+cachedDesc.length]; + + switch (nalHeader) + { + // SPS and PPS + case 0x67: + case 0x68: + System.out.println("Codec config"); + //flags |= MediaCodec.BUFFER_FLAG_CODEC_CONFIG; + break; + + // IDR + case 0x65: + System.out.println("Reference frame"); + //flags |= MediaCodec.BUFFER_FLAG_SYNC_FRAME; + break; + + // non-IDR frame + case 0x61: + break; + + // Unknown type + default: + System.out.printf("Unknown NAL header: %02x %02x %02x %02x %02x\n", + header.data[header.offset], header.data[header.offset+1], + header.data[header.offset+2], header.data[header.offset+3], + header.data[header.offset+4]); + break; + } + } + else + { + System.out.printf("Invalid NAL: %02x %02x %02x %02x %02x\n", + header.data[header.offset], header.data[header.offset+1], + header.data[header.offset+2], header.data[header.offset+3], + header.data[header.offset+4]); + } + + // Construct the H264 decode unit + AvDecodeUnit du = new AvDecodeUnit(AvDecodeUnit.TYPE_H264, avcNalDataChain, avcNalDataLength, flags); + if (!decodedUnits.offer(du)) { + // We need a new IDR frame since we're discarding data now + decodedUnits.clear(); + controlListener.connectionNeedsResync(); + } + + // Clear old state + avcNalDataChain = null; + avcNalDataLength = 0; + } + } + + public void addInputData(AvVideoPacket packet) + { + AvByteBufferDescriptor location = packet.getNewPayloadDescriptor(); + + while (location.length != 0) + { + // Remember the start of the NAL data in this packet + int start = location.offset; + + // Check for a special sequence + if (NAL.getSpecialSequenceDescriptor(location, cachedDesc)) + { + if (NAL.isAvcStartSequence(cachedDesc)) + { + // We're decoding H264 now + currentlyDecoding = AvDecodeUnit.TYPE_H264; + + // Check if it's the end of the last frame + if (NAL.isAvcFrameStart(cachedDesc)) + { + // Reassemble any pending AVC NAL + reassembleAvcNal(); + + // Setup state for the new NAL + avcNalDataChain = new LinkedList(); + avcNalDataLength = 0; + } + + // Skip the start sequence + location.length -= cachedDesc.length; + location.offset += cachedDesc.length; + } + else + { + // Check if this is padding after a full AVC frame + if (currentlyDecoding == AvDecodeUnit.TYPE_H264 && + NAL.isPadding(cachedDesc)) { + // The decode unit is complete + reassembleAvcNal(); + } + + // Not decoding AVC + currentlyDecoding = AvDecodeUnit.TYPE_UNKNOWN; + + // Just skip this byte + location.length--; + location.offset++; + } + } + + // Move to the next special sequence + while (location.length != 0) + { + // Catch the easy case first where byte 0 != 0x00 + if (location.data[location.offset] == 0x00) + { + // Check if this should end the current NAL + if (NAL.getSpecialSequenceDescriptor(location, cachedDesc)) + { + // Only stop if we're decoding something or this + // isn't padding + if (currentlyDecoding != AvDecodeUnit.TYPE_UNKNOWN || + !NAL.isPadding(cachedDesc)) + { + break; + } + } + } + + // This byte is part of the NAL data + location.offset++; + location.length--; + } + + if (currentlyDecoding == AvDecodeUnit.TYPE_H264 && avcNalDataChain != null) + { + AvByteBufferDescriptor data = new AvByteBufferDescriptor(location.data, start, location.offset-start); + + // Add a buffer descriptor describing the NAL data in this packet + avcNalDataChain.add(data); + avcNalDataLength += location.offset-start; + } + } + } + + public void addInputData(AvRtpPacket packet) + { + short seq = packet.getSequenceNumber(); + + // Toss out the current NAL if we receive a packet that is + // out of sequence + if (lastSequenceNumber != 0 && + (short)(lastSequenceNumber + 1) != seq) + { + System.out.println("Received OOS video data (expected "+(lastSequenceNumber + 1)+", got "+seq+")"); + + // Reset the depacketizer state + currentlyDecoding = AvDecodeUnit.TYPE_UNKNOWN; + clearAvcNalState(); + + // Request an IDR frame + controlListener.connectionNeedsResync(); + } + + lastSequenceNumber = seq; + + // Pass the payload to the non-sequencing parser + AvByteBufferDescriptor rtpPayload = packet.getNewPayloadDescriptor(); + addInputData(new AvVideoPacket(rtpPayload)); + } + + public AvDecodeUnit getNextDecodeUnit() throws InterruptedException + { + return decodedUnits.take(); + } +} + +class NAL { + + // This assumes that the buffer passed in is already a special sequence + public static boolean isAvcStartSequence(AvByteBufferDescriptor specialSeq) + { + // The start sequence is 00 00 01 or 00 00 00 01 + return (specialSeq.data[specialSeq.offset+specialSeq.length-1] == 0x01); + } + + // This assumes that the buffer passed in is already a special sequence + public static boolean isPadding(AvByteBufferDescriptor specialSeq) + { + // The padding sequence is 00 00 00 + return (specialSeq.data[specialSeq.offset+specialSeq.length-1] == 0x00); + } + + // This assumes that the buffer passed in is already a special sequence + public static boolean isAvcFrameStart(AvByteBufferDescriptor specialSeq) + { + if (specialSeq.length != 4) + return false; + + // The frame start sequence is 00 00 00 01 + return (specialSeq.data[specialSeq.offset+specialSeq.length-1] == 0x01); + } + + // Returns a buffer descriptor describing the start sequence + public static boolean getSpecialSequenceDescriptor(AvByteBufferDescriptor buffer, AvByteBufferDescriptor outputDesc) + { + // NAL start sequence is 00 00 00 01 or 00 00 01 + if (buffer.length < 3) + return false; + + // 00 00 is magic + if (buffer.data[buffer.offset] == 0x00 && + buffer.data[buffer.offset+1] == 0x00) + { + // Another 00 could be the end of the special sequence + // 00 00 00 or the middle of 00 00 00 01 + if (buffer.data[buffer.offset+2] == 0x00) + { + if (buffer.length >= 4 && + buffer.data[buffer.offset+3] == 0x01) + { + // It's the AVC start sequence 00 00 00 01 + outputDesc.reinitialize(buffer.data, buffer.offset, 4); + } + else + { + // It's 00 00 00 + outputDesc.reinitialize(buffer.data, buffer.offset, 3); + } + return true; + } + else if (buffer.data[buffer.offset+2] == 0x01 || + buffer.data[buffer.offset+2] == 0x02) + { + // These are easy: 00 00 01 or 00 00 02 + outputDesc.reinitialize(buffer.data, buffer.offset, 3); + return true; + } + else if (buffer.data[buffer.offset+2] == 0x03) + { + // 00 00 03 is special because it's a subsequence of the + // NAL wrapping substitute for 00 00 00, 00 00 01, 00 00 02, + // or 00 00 03 in the RBSP sequence. We need to check the next + // byte to see whether it's 00, 01, 02, or 03 (a valid RBSP substitution) + // or whether it's something else + + if (buffer.length < 4) + return false; + + if (buffer.data[buffer.offset+3] >= 0x00 && + buffer.data[buffer.offset+3] <= 0x03) + { + // It's not really a special sequence after all + return false; + } + else + { + // It's not a standard replacement so it's a special sequence + outputDesc.reinitialize(buffer.data, buffer.offset, 3); + return true; + } + } + } + + return false; + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/video/AvVideoPacket.java b/limelight-pc/src/com/limelight/nvstream/av/video/AvVideoPacket.java new file mode 100644 index 0000000..d2bd844 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/video/AvVideoPacket.java @@ -0,0 +1,17 @@ +package com.limelight.nvstream.av.video; + +import com.limelight.nvstream.av.AvByteBufferDescriptor; + +public class AvVideoPacket { + private AvByteBufferDescriptor buffer; + + public AvVideoPacket(AvByteBufferDescriptor rtpPayload) + { + buffer = new AvByteBufferDescriptor(rtpPayload); + } + + public AvByteBufferDescriptor getNewPayloadDescriptor() + { + return new AvByteBufferDescriptor(buffer.data, buffer.offset+56, buffer.length-56); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/video/AvcDecoder.java b/limelight-pc/src/com/limelight/nvstream/av/video/AvcDecoder.java new file mode 100644 index 0000000..249f4ac --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/video/AvcDecoder.java @@ -0,0 +1,33 @@ +package com.limelight.nvstream.av.video; + +public class AvcDecoder { + static { + // FFMPEG dependencies + System.loadLibrary("avutil-52"); + System.loadLibrary("swresample-0"); + System.loadLibrary("swscale-2"); + System.loadLibrary("avcodec-55"); + System.loadLibrary("avformat-55"); + System.loadLibrary("avfilter-3"); + + System.loadLibrary("nv_avc_dec"); + } + + /** Disables the deblocking filter at the cost of image quality */ + public static final int DISABLE_LOOP_FILTER = 0x1; + /** Uses the low latency decode flag (disables multithreading) */ + public static final int LOW_LATENCY_DECODE = 0x2; + /** Threads process each slice, rather than each frame */ + public static final int SLICE_THREADING = 0x4; + /** Uses nonstandard speedup tricks */ + public static final int FAST_DECODE = 0x8; + /** Uses bilinear filtering instead of bicubic */ + public static final int BILINEAR_FILTERING = 0x10; + /** Uses a faster bilinear filtering with lower image quality */ + public static final int FAST_BILINEAR_FILTERING = 0x20; + + public static native int init(int width, int height, int perflvl, int threadcount); + public static native void destroy(); + //public static native void redraw(Surface surface); + public static native int decode(byte[] indata, int inoff, int inlen); +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/video/CpuDecoderRenderer.java b/limelight-pc/src/com/limelight/nvstream/av/video/CpuDecoderRenderer.java new file mode 100644 index 0000000..dea3910 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/video/CpuDecoderRenderer.java @@ -0,0 +1,203 @@ +package com.limelight.nvstream.av.video; + +import java.io.BufferedReader; +import java.io.File; +import java.io.FileReader; +import java.io.IOException; +import java.nio.ByteBuffer; + +import com.limelight.nvstream.av.AvByteBufferDescriptor; +import com.limelight.nvstream.av.AvDecodeUnit; + +public class CpuDecoderRenderer/* implements DecoderRenderer */{ + + private ByteBuffer decoderBuffer; + private Thread rendererThread; + private int targetFps; + + // Only sleep if the difference is above this value + private static final int WAIT_CEILING_MS = 8; + + private static final int LOW_PERF = 1; + private static final int MED_PERF = 2; + private static final int HIGH_PERF = 3; + + private int cpuCount = Runtime.getRuntime().availableProcessors(); + + private int findOptimalPerformanceLevel() { + StringBuilder cpuInfo = new StringBuilder(); + BufferedReader br = null; + try { + br = new BufferedReader(new FileReader(new File("/proc/cpuinfo"))); + for (;;) { + int ch = br.read(); + if (ch == -1) + break; + cpuInfo.append((char)ch); + } + + // Here we're doing very simple heuristics based on CPU model + String cpuInfoStr = cpuInfo.toString(); + + // We order them from greatest to least for proper detection + // of devices with multiple sets of cores (like Exynos 5 Octa) + // TODO Make this better + if (cpuInfoStr.contains("0xc0f")) { + // Cortex-A15 + return MED_PERF; + } + else if (cpuInfoStr.contains("0xc09")) { + // Cortex-A9 + return LOW_PERF; + } + else if (cpuInfoStr.contains("0xc07")) { + // Cortex-A7 + return LOW_PERF; + } + else { + // Didn't have anything we're looking for + return MED_PERF; + } + } catch (IOException e) { + } finally { + if (br != null) { + try { + br.close(); + } catch (IOException e) {} + } + } + + // Couldn't read cpuinfo, so assume medium + return MED_PERF; + } + + /*@Override + public void setup(int width, int height, SurfaceHolder renderTarget, int drFlags) { + this.renderTarget = renderTarget.getSurface(); + this.targetFps = 30; + + int perfLevel = findOptimalPerformanceLevel(); + int threadCount; + + int avcFlags = 0; + switch (perfLevel) { + case HIGH_PERF: + // Single threaded low latency decode is ideal but hard to acheive + avcFlags = AvcDecoder.LOW_LATENCY_DECODE; + threadCount = 1; + break; + + case LOW_PERF: + // Disable the loop filter for performance reasons + avcFlags = AvcDecoder.DISABLE_LOOP_FILTER | + AvcDecoder.FAST_BILINEAR_FILTERING | + AvcDecoder.FAST_DECODE; + + // Use plenty of threads to try to utilize the CPU as best we can + threadCount = cpuCount - 1; + break; + + default: + case MED_PERF: + avcFlags = AvcDecoder.BILINEAR_FILTERING | + AvcDecoder.FAST_DECODE; + + // Only use 2 threads to minimize frame processing latency + threadCount = 2; + break; + } + + // If the user wants quality, we'll remove the low IQ flags + if ((drFlags & DecoderRenderer.FLAG_PREFER_QUALITY) != 0) { + // Make sure the loop filter is enabled + avcFlags &= ~AvcDecoder.DISABLE_LOOP_FILTER; + + // Disable the non-compliant speed optimizations + avcFlags &= ~AvcDecoder.FAST_DECODE; + + System.out.println("Using high quality decoding"); + } + + int err = AvcDecoder.init(width, height, avcFlags, threadCount); + if (err != 0) { + throw new IllegalStateException("AVC decoder initialization failure: "+err); + } + + decoderBuffer = ByteBuffer.allocate(92*1024); + + System.out.println("Using software decoding (performance level: "+perfLevel+")"); + } +*/ + //@Override + public void start() { + rendererThread = new Thread() { + @Override + public void run() { + long nextFrameTime = System.currentTimeMillis(); + + while (!isInterrupted()) + { + long diff = nextFrameTime - System.currentTimeMillis(); + + if (diff > WAIT_CEILING_MS) { + try { + Thread.sleep(diff); + } catch (InterruptedException e) { + return; + } + } + + nextFrameTime = computePresentationTimeMs(targetFps); + // AvcDecoder.redraw(renderTarget); + } + } + }; + rendererThread.setName("Video - Renderer (CPU)"); + rendererThread.start(); + } + + private long computePresentationTimeMs(int frameRate) { + return System.currentTimeMillis() + (1000 / frameRate); + } + + //@Override + public void stop() { + rendererThread.interrupt(); + + try { + rendererThread.join(); + } catch (InterruptedException e) { } + } + + //@Override + public void release() { + AvcDecoder.destroy(); + } + + //@Override + public boolean submitDecodeUnit(AvDecodeUnit decodeUnit) { + byte[] data; + + // Use the reserved decoder buffer if this decode unit will fit + if (decodeUnit.getDataLength() <= decoderBuffer.limit()) { + decoderBuffer.clear(); + + for (AvByteBufferDescriptor bbd : decodeUnit.getBufferList()) { + decoderBuffer.put(bbd.data, bbd.offset, bbd.length); + } + + data = decoderBuffer.array(); + } + else { + data = new byte[decodeUnit.getDataLength()]; + + int offset = 0; + for (AvByteBufferDescriptor bbd : decodeUnit.getBufferList()) { + System.arraycopy(bbd.data, bbd.offset, data, offset, bbd.length); + offset += bbd.length; + } + } + + return (AvcDecoder.decode(data, 0, decodeUnit.getDataLength()) == 0); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/av/video/DecoderRenderer.java b/limelight-pc/src/com/limelight/nvstream/av/video/DecoderRenderer.java new file mode 100644 index 0000000..43555f8 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/av/video/DecoderRenderer.java @@ -0,0 +1,17 @@ +package com.limelight.nvstream.av.video; + +import com.limelight.nvstream.av.AvDecodeUnit; + +public interface DecoderRenderer { + public static int FLAG_PREFER_QUALITY = 0x1; + + public void setup(int width, int height, int drFlags); + + public void start(); + + public void stop(); + + public void release(); + + public boolean submitDecodeUnit(AvDecodeUnit decodeUnit); +} diff --git a/limelight-pc/src/com/limelight/nvstream/input/NvController.java b/limelight-pc/src/com/limelight/nvstream/input/NvController.java new file mode 100644 index 0000000..b1b273e --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/input/NvController.java @@ -0,0 +1,65 @@ +package com.limelight.nvstream.input; + +import java.io.IOException; +import java.io.OutputStream; +import java.net.InetAddress; +import java.net.InetSocketAddress; +import java.net.Socket; + +public class NvController { + + public final static int PORT = 35043; + + public final static int CONTROLLER_TIMEOUT = 3000; + + private InetAddress host; + private Socket s; + private OutputStream out; + + public NvController(InetAddress host) + { + this.host = host; + } + + public void initialize() throws IOException + { + s = new Socket(); + s.connect(new InetSocketAddress(host, PORT), CONTROLLER_TIMEOUT); + s.setTcpNoDelay(true); + out = s.getOutputStream(); + } + + public void close() + { + try { + s.close(); + } catch (IOException e) {} + } + + public void sendControllerInput(short buttonFlags, byte leftTrigger, byte rightTrigger, + short leftStickX, short leftStickY, short rightStickX, short rightStickY) throws IOException + { + out.write(new NvControllerPacket(buttonFlags, leftTrigger, + rightTrigger, leftStickX, leftStickY, + rightStickX, rightStickY).toWire()); + out.flush(); + } + + public void sendMouseButtonDown() throws IOException + { + out.write(new NvMouseButtonPacket(true).toWire()); + out.flush(); + } + + public void sendMouseButtonUp() throws IOException + { + out.write(new NvMouseButtonPacket(false).toWire()); + out.flush(); + } + + public void sendMouseMove(short deltaX, short deltaY) throws IOException + { + out.write(new NvMouseMovePacket(deltaX, deltaY).toWire()); + out.flush(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/input/NvControllerPacket.java b/limelight-pc/src/com/limelight/nvstream/input/NvControllerPacket.java new file mode 100644 index 0000000..06ab006 --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/input/NvControllerPacket.java @@ -0,0 +1,89 @@ +package com.limelight.nvstream.input; + +import java.nio.ByteBuffer; +import java.nio.ByteOrder; + +public class NvControllerPacket extends NvInputPacket { + public static final byte[] HEADER = + { + 0x0A, + 0x00, + 0x00, + 0x00, + 0x00, + 0x14 + }; + + public static final byte[] TAIL = + { + (byte)0x9C, + 0x00, + 0x00, + 0x00, + 0x55, + 0x00 + }; + + public static final int PACKET_TYPE = 0x18; + + public static final short A_FLAG = 0x1000; + public static final short B_FLAG = 0x2000; + public static final short X_FLAG = 0x4000; + public static final short Y_FLAG = (short)0x8000; + public static final short UP_FLAG = 0x0001; + public static final short DOWN_FLAG = 0x0002; + public static final short LEFT_FLAG = 0x0004; + public static final short RIGHT_FLAG = 0x0008; + public static final short LB_FLAG = 0x0100; + public static final short RB_FLAG = 0x0200; + public static final short PLAY_FLAG = 0x0010; + public static final short BACK_FLAG = 0x0020; + public static final short LS_CLK_FLAG = 0x0040; + public static final short RS_CLK_FLAG = 0x0080; + public static final short SPECIAL_BUTTON_FLAG = 0x0400; + + public static final short PAYLOAD_LENGTH = 24; + public static final short PACKET_LENGTH = PAYLOAD_LENGTH + + NvInputPacket.HEADER_LENGTH; + + private short buttonFlags; + private byte leftTrigger; + private byte rightTrigger; + private short leftStickX; + private short leftStickY; + private short rightStickX; + private short rightStickY; + + public NvControllerPacket(short buttonFlags, byte leftTrigger, byte rightTrigger, + short leftStickX, short leftStickY, + short rightStickX, short rightStickY) + { + super(PACKET_TYPE); + + this.buttonFlags = buttonFlags; + this.leftTrigger = leftTrigger; + this.rightTrigger = rightTrigger; + this.leftStickX = leftStickX; + this.leftStickY = leftStickY; + this.rightStickX = rightStickX; + this.rightStickY = rightStickY; + } + + public byte[] toWire() + { + ByteBuffer bb = ByteBuffer.allocate(PACKET_LENGTH).order(ByteOrder.LITTLE_ENDIAN); + + bb.put(toWireHeader()); + bb.put(HEADER); + bb.putShort(buttonFlags); + bb.put(leftTrigger); + bb.put(rightTrigger); + bb.putShort(leftStickX); + bb.putShort(leftStickY); + bb.putShort(rightStickX); + bb.putShort(rightStickY); + bb.put(TAIL); + + return bb.array(); + } + } \ No newline at end of file diff --git a/limelight-pc/src/com/limelight/nvstream/input/NvInputPacket.java b/limelight-pc/src/com/limelight/nvstream/input/NvInputPacket.java new file mode 100644 index 0000000..ec98b2d --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/input/NvInputPacket.java @@ -0,0 +1,26 @@ +package com.limelight.nvstream.input; + +import java.nio.ByteBuffer; +import java.nio.ByteOrder; + +public abstract class NvInputPacket { + public static final int HEADER_LENGTH = 0x4; + + protected int packetType; + + public NvInputPacket(int packetType) + { + this.packetType = packetType; + } + + public abstract byte[] toWire(); + + public byte[] toWireHeader() + { + ByteBuffer bb = ByteBuffer.allocate(4).order(ByteOrder.BIG_ENDIAN); + + bb.putInt(packetType); + + return bb.array(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/input/NvMouseButtonPacket.java b/limelight-pc/src/com/limelight/nvstream/input/NvMouseButtonPacket.java new file mode 100644 index 0000000..8cb87ac --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/input/NvMouseButtonPacket.java @@ -0,0 +1,36 @@ +package com.limelight.nvstream.input; + +import java.nio.ByteBuffer; +import java.nio.ByteOrder; + +public class NvMouseButtonPacket extends NvInputPacket { + + private byte buttonEventType; + + public static final int PACKET_TYPE = 0x5; + public static final int PAYLOAD_LENGTH = 5; + public static final int PACKET_LENGTH = PAYLOAD_LENGTH + + NvInputPacket.HEADER_LENGTH; + + public static final byte PRESS_EVENT = 0x07; + public static final byte RELEASE_EVENT = 0x08; + + public NvMouseButtonPacket(boolean leftButtonDown) + { + super(PACKET_TYPE); + + buttonEventType = leftButtonDown ? + PRESS_EVENT : RELEASE_EVENT; + } + + @Override + public byte[] toWire() { + ByteBuffer bb = ByteBuffer.allocate(PACKET_LENGTH).order(ByteOrder.BIG_ENDIAN); + + bb.put(toWireHeader()); + bb.put(buttonEventType); + bb.putInt(1); // FIXME: button index? + + return bb.array(); + } +} diff --git a/limelight-pc/src/com/limelight/nvstream/input/NvMouseMovePacket.java b/limelight-pc/src/com/limelight/nvstream/input/NvMouseMovePacket.java new file mode 100644 index 0000000..edafa9c --- /dev/null +++ b/limelight-pc/src/com/limelight/nvstream/input/NvMouseMovePacket.java @@ -0,0 +1,42 @@ +package com.limelight.nvstream.input; + +import java.nio.ByteBuffer; + +public class NvMouseMovePacket extends NvInputPacket { + + private static final byte[] HEADER = + { + 0x06, + 0x00, + 0x00, + 0x00 + }; + + public static final int PACKET_TYPE = 0x8; + public static final int PAYLOAD_LENGTH = 8; + public static final int PACKET_LENGTH = PAYLOAD_LENGTH + + NvInputPacket.HEADER_LENGTH; + + private short deltaX; + private short deltaY; + + public NvMouseMovePacket(short deltaX, short deltaY) + { + super(PACKET_TYPE); + + this.deltaX = deltaX; + this.deltaY = deltaY; + } + + @Override + public byte[] toWire() { + ByteBuffer bb = ByteBuffer.allocate(PACKET_LENGTH); + + bb.put(toWireHeader()); + bb.put(HEADER); + bb.putShort(deltaX); + bb.putShort(deltaY); + + return bb.array(); + } +}